Olcegepant

{{Short description|Chemical compound}}

{{Drugbox

| IUPAC_name = N-[(1R)-2-[[(1S)-5-Amino-1-[[4-(pyridin-4-yl)piperazin-1-yl]carbonyl]pentyl]amino]-1-(3,5-dibromo-4-hydroxybenzyl)-2-oxoethyl]-4-(2-oxo-1,4-dihydroquinazolin-3(2H)-yl)piperidine-1-carboxamide

| image = Olcegepant.svg

| width = 300

| CAS_number = 204697-65-4

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = WOA5J8TX6M

| ATC_prefix = None

| ATC_suffix =

| PubChem = 6918509

| DrugBank =

| ChemSpiderID = 5293706

| chemical_formula =

| C=38 | H=47 | Br=2 | N=9 | O=5

| SMILES = C1CN(CCC1N2CC3=CC=CC=C3NC2=O)C(=O)N[C@H](CC4=CC(=C(C(=C4)Br)O)Br)C(=O)N[C@@H](CCCCN)C(=O)N5CCN(CC5)C6=CC=NC=C6

| StdInChI = 1S/C38H47Br2N9O5/c39-29-21-25(22-30(40)34(29)50)23-33(45-37(53)48-15-10-28(11-16-48)49-24-26-5-1-2-6-31(26)44-38(49)54)35(51)43-32(7-3-4-12-41)36(52)47-19-17-46(18-20-47)27-8-13-42-14-9-27/h1-2,5-6,8-9,13-14,21-22,28,32-33,50H,3-4,7,10-12,15-20,23-24,41H2,(H,43,51)(H,44,54)(H,45,53)/t32-,33+/m0/s1

| StdInChIKey = ITIXDWVDFFXNEG-JHOUSYSJSA-N

| bioavailability =

| protein_bound =

| metabolism =

| elimination_half-life =

| excretion =

| pregnancy_AU =

| pregnancy_US =

| pregnancy_category =

| legal_AU =

| legal_CA =

| legal_UK =

| legal_US =

| legal_status =

| routes_of_administration =

}}

Olcegepant (INN,{{cite web | title = International Nonproprietary Names for Pharmaceutical Substances (INN). Recommended International Nonproprietary Names: List 48 | url =https://www.who.int/medicines/publications/druginformation/innlists/RL48.pdf | publisher = World Health Organization | access-date = 20 March 2017 | pages = 256–7}} code name BIBN-4096BS) is a calcitonin gene-related peptide receptor antagonist being studied as a potential treatment for migraines.{{cite journal | vauthors = Tfelt-Hansen P, Olesen J | title = Possible site of action of CGRP antagonists in migraine | journal = Cephalalgia | volume = 31 | issue = 6 | pages = 748–50 | date = April 2011 | pmid = 21383046 | doi = 10.1177/0333102411398403 | s2cid = 22049557 | doi-access = free }}

A 2013 meta-analysis found olcegepant and telcagepant were effective and safe compared to placebo.{{cite journal | vauthors = Yao G, Yu T, Han X, Mao X, Li B | title = Therapeutic effects and safety of olcegepant and telcagepant for migraine: A meta-analysis | journal = Neural Regeneration Research | volume = 8 | issue = 10 | pages = 938–47 | date = April 2013 | pmid = 25206386 | pmc = 4145922 | doi = 10.3969/j.issn.1673-5374.2013.10.009 }}