Olsalazine

{{Short description|Pharmaceutical drug used for ulcerative colitis}}

{{MCN|date=March 2025}}

{{Drugbox

| Verifiedfields = changed

| verifiedrevid = 462265233

| image = Olsalazine.svg

| tradename = Dipentum

| Drugs.com = {{drugs.com|monograph|olsalazine-sodium}}

| MedlinePlus = a601088

| DailyMedID = Olsalazine

| pregnancy_AU = C

| pregnancy_AU_comment = {{cite web | title=Olsalazine (Dipentum) Use During Pregnancy | website=Drugs.com | date=6 September 2019 | url=https://www.drugs.com/pregnancy/olsalazine.html | access-date=9 October 2020}}

| pregnancy_US = C

| pregnancy_US_comment =

| pregnancy_category =

| legal_AU = S4

| legal_CA =

| legal_UK = POM

| legal_US = Rx-only

| legal_status =

| routes_of_administration = By mouth

| ATC_prefix = A07

| ATC_suffix = EC03

| bioavailability =

| protein_bound = 99%

| metabolism =

| elimination_half-life = 0.9 hours

| excretion =

| index2_label = as salt

| CAS_number_Ref = {{cascite|correct|??}}

| CAS_number = 15722-48-2

| PubChem = 22419

| DrugBank_Ref = {{drugbankcite|correct|drugbank}}

| DrugBank = DB01250

| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}

| ChemSpiderID = 10642377

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = ULS5I8J03O

| KEGG_Ref = {{keggcite|changed|kegg}}

| KEGG = D08295

| KEGG2_Ref = {{keggcite|changed|kegg}}

| KEGG2 = D00727

| ChEBI_Ref =

| ChEBI =

| ChEMBL_Ref = {{ebicite|changed|EBI}}

| ChEMBL = 425

| NIAID_ChemDB =

| PDB_ligand =

| synonyms =

| C=14 | H=10 | N=2 | O=6

| smiles = O=C(O)c1cc(ccc1O)/N=N/c2cc(C(O)=O)c(O)cc2

| StdInChI_Ref = {{stdinchicite|correct|chemspider}}

| StdInChI = 1S/C14H10N2O6/c17-11-3-1-7(5-9(11)13(19)20)15-16-8-2-4-12(18)10(6-8)14(21)22/h1-6,17-18H,(H,19,20)(H,21,22)/b16-15+

| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}

| StdInChIKey = QQBDLJCYGRGAKP-FOCLMDBBSA-N

}}

Olsalazine is an anti-inflammatory medication used in the treatment of ulcerative colitis.{{cite journal | vauthors = | title = Olsalazine--a further choice in ulcerative colitis | journal = Drug and Therapeutics Bulletin | volume = 28 | issue = 15 | pages = 57–8 | date = July 1990 | pmid = 2131213 | doi = 10.1136/dtb.28.15.57 | s2cid = 7178709 }}{{cite journal | vauthors = Wadworth AN, Fitton A | title = Olsalazine. A review of its pharmacodynamic and pharmacokinetic properties, and therapeutic potential in inflammatory bowel disease | journal = Drugs | volume = 41 | issue = 4 | pages = 647–64 | date = April 1991 | pmid = 1711964 | doi = 10.2165/00003495-199141040-00009 | s2cid = 243654426 }} It is sold under the brand name Dipentum.{{cite web |title=Olsalazine Sodium 250 mg Capsules - Summary of Product Characteristics (SmPC) - (emc) |url=https://www.medicines.org.uk/emc/product/3708/smpc#gref |website=www.medicines.org.uk |access-date=9 January 2021}}

Olsalazine itself is a pro-drug of mesalazine (5-aminosalicyclic acid or 5-ASA) and is not absorbed in the small intestine. Instead it continues through to the colon where it is cleaved into two molecules of 5-ASA by azoreductases produced by colonic bacteria. Olsalazine thus exerts its anti-inflammatory effect by its colonic breakdown into 5-ASA which inhibits cyclooxygenase and lipoxygenase thereby reducing prostaglandin and leukotriene production.

History

Olsalazine gained Food and Drug Administration (FDA) approval in 1990.

Supply

The drug is supplied by UCB Pharma.

Research

In 2006 the Australian biotech company Giaconda received a European patent for a combination therapy for treating constipation-predominant irritable bowel syndrome that uses olsalazine and the anti-gout drug colchicine, for trials the following year.{{cite news |title=Giaconda gets European patent for drug |url=https://www.smh.com.au/business/giaconda-gets-european-patent-for-drug-20061228-gdp4vv.html |access-date=16 January 2021 |work=The Sydney Morning Herald |date=28 December 2006 |language=en}}

References

{{reflist}}

{{Antidiarrheals, intestinal anti-inflammatory/anti-infective agents}}

{{Portal bar | Medicine}}

Category:Gastroenterology

Category:Hydrazones

Category:Salicylic acids

Category:Prodrugs