Onfasprodil

{{Short description|Chemical compound}}

{{Infobox drug

| drug_name =

| INN =

| type =

| image = Onfasprodil.svg

| alt =

| caption =

| pronounce =

| tradename =

| Drugs.com =

| MedlinePlus =

| pregnancy_AU =

| pregnancy_AU_comment =

| pregnancy_category=

| routes_of_administration =

| ATCvet =

| ATC_prefix =

| ATC_suffix =

| class = NMDA receptor modulator

| legal_AU =

| legal_AU_comment =

| legal_BR =

| legal_BR_comment =

| legal_CA =

| legal_CA_comment =

| legal_DE =

| legal_DE_comment =

| legal_NZ =

| legal_NZ_comment =

| legal_UK =

| legal_UK_comment =

| legal_US =

| legal_US_comment =

| legal_EU =

| legal_EU_comment =

| legal_UN =

| legal_UN_comment =

| legal_status = Investigational

| bioavailability =

| protein_bound =

| metabolism =

| metabolites =

| onset =

| elimination_half-life =

| duration_of_action=

| excretion =

| synonyms = MIJ821

| CAS_number = 1892581-29-1

| PubChem = 118981713

| DrugBank =

| KEGG = D12787

| ChemSpiderID = 115010425

| UNII = C6I8M5AWKP

| ChEMBL = 5095074

| IUPAC_name = 6-{(1S)-2-[(3aR,5R,6aS)-5-(2-Fluorophenoxy)hexahydrocyclopenta[c]pyrrol-2(1H)-yl]-1-hydroxyethyl}-3-pyridinol

| C = 20 | H = 23 | F = 1 | N = 2 | O = 3

| smiles = O([C@@H]1C[C@@]2([C@](C1)(CN(C[C@H](O)C3=CC=C(O)C=N3)C2)[H])[H])C4=C(F)C=CC=C4

| StdInChI = 1S/C20H23FN2O3/c21-17-3-1-2-4-20(17)26-16-7-13-10-23(11-14(13)8-16)12-19(25)18-6-5-15(24)9-22-18/h1-6,9,13-14,16,19,24-25H,7-8,10-12H2/t13-,14+,16+,19-/m0/s1

| StdInChIKey = NEFQLCKWVRZEJA-ZDXGLAPJSA-N

}}

Onfasprodil (MIJ821) is a drug delivered via intravenous infusion that is designed as a fast-acting treatment for treatment-resistant depression. It works as a negative allosteric modulator of the NMDA receptor subunit 2B (NR2B). The drug is developed by Novartis.{{cite journal |last1=Gomez-Mancilla |first1=Baltazar |last2=Levy |first2=Jeffrey A. |last3=Ganesan |first3=Subramanian |last4=Faller |first4=Thomas |last5=Issachar |first5=Gil |last6=Peremen |first6=Ziv |last7=Laufer |first7=Offir |last8=Shani-Hershkovich |first8=Revital |last9=Biliouris |first9=Kostas |last10=Walker |first10=Ela |last11=Healy |first11=Mark P. |last12=Sverdlov |first12=Oleksandr |last13=Desai |first13=Sachin |last14=Ghaemi |first14=S. Nassir |last15=Cha |first15=Jang-Ho |last16=Shanker |first16=Y. Gopi |title=MIJ821 (onfasprodil) in healthy volunteers: First-in-human, randomized, placebo-controlled study (single ascending dose and repeated intravenous dose) |journal=Clinical and Translational Science |date=November 2023 |volume=16 |issue=11 |pages=2236–2252 |doi=10.1111/cts.13623|pmid=37817426 |pmc=10651655 }}{{cite journal |last1=Osaka |first1=Hitoshi |last2=Kanazawa |first2=Tetsufumi |title=Emerging trends in antipsychotic and antidepressant drug development: Targeting nonmonoamine receptors and innovative mechanisms |journal=Psychiatry and Clinical Neurosciences Reports |date=December 2023 |volume=2 |issue=4 |pages=e157 |doi=10.1002/pcn5.157|s2cid=265360324 |doi-access=free |pmid=38868733 |pmc=11114387 }}

References