Opigolix

{{Short description|Chemical compound}}

{{Drugbox

| Verifiedfields =

| Watchedfields =

| verifiedrevid =

| IUPAC_name = (2R)-N'-[5-[3-(2,5-difluorophenyl)-2-(1,3-dihydrobenzimidazol-2-ylidene)-3-oxopropanoyl]-2-fluorophenyl]sulfonyl-2-hydroxypropanimidamide

| image = Opigolix.svg

| width = 250px

| tradename =

| pregnancy_AU =

| pregnancy_US =

| pregnancy_category =

| legal_AU =

| legal_CA =

| legal_UK =

| legal_US =

| legal_status =

| routes_of_administration = By mouth

| class = GnRH modulator; GnRH antagonist; Antigonadotropin

| bioavailability =

| protein_bound =

| metabolism =

| elimination_half-life =

| excretion =

| CAS_number_Ref = {{cascite|correct|CAS}}

| CAS_number = 912587-25-8

| CAS_supplemental =

| ATC_prefix =

| ATC_suffix =

| ATC_supplemental =

| PubChem = 11977994

| IUPHAR_ligand =

| DrugBank_Ref =

| DrugBank =

| ChemSpiderID_Ref =

| ChemSpiderID =

| UNII = VQ6CK0CITA

| KEGG = D11351

| ChEBI =

| ChEMBL =

| synonyms = ASP-1707

| C=25 | H=19 | F=3 | N=4 | O=5 | S=1

| SMILES = C[C@@H](O)/C(N)=N/S(=O)(=O)c1cc(C(=O)C(C(=O)c2cc(F)ccc2F)=C2Nc3ccccc3N2)ccc1F

| StdInChI_Ref =

| StdInChI = 1S/C25H19F3N4O5S/c1-12(33)24(29)32-38(36,37)20-10-13(6-8-17(20)28)22(34)21(23(35)15-11-14(26)7-9-16(15)27)25-30-18-4-2-3-5-19(18)31-25/h2-12,30-31,33H,1H3,(H2,29,32)/t12-/m1/s1

| StdInChIKey_Ref =

| StdInChIKey = CWNLBPBIFALUQD-GFCCVEGCSA-N

}}

Opigolix ({{abbrlink|INN|International Nonproprietary Name}}, {{abbrlink|USAN|United States Adopted Name}}; developmental code name ASP-1707) is a small-molecule, non-peptide, orally active gonadotropin-releasing hormone antagonist (GnRH antagonist) which was under development by Astellas Pharma for the treatment of endometriosis and rheumatoid arthritis.{{Cite web |title=Opigolix - Astellas Pharma - AdisInsight |url=http://adisinsight.springer.com/drugs/800032657}}{{Cite journal |vauthors=Ezzati M, Carr BR |year=2015 |title=Elagolix, a novel, orally bioavailable GnRH antagonist under investigation for the treatment of endometriosis-related pain |journal=Women's Health |volume=11 |issue=1 |pages=19–28 |doi=10.2217/whe.14.68 |pmid=25581052 |doi-access=free}} It was also under investigation for the treatment of prostate cancer. It reached phase II clinical trials for both endometriosis and rheumatoid arthritis prior to the discontinuation of its development in April 2018.