Orange GGN

{{Chembox

| verifiedrevid = 420435661

| ImageFile = Orange GGN.png

| ImageSize =

| IUPACName =

| OtherNames = {{Unbulleted list|1-(m-Sulfophenylazo)-2-naphthol-6-sulfonic acid, disodium salt}}

| Section1 = {{Chembox Identifiers

| InChI = 1/C16H12N2O7S2.2Na/c19-15-7-4-10-8-13(27(23,24)25)5-6-14(10)16(15)18-17-11-2-1-3-12(9-11)26(20,21)22;;/h1-9,19H,(H,20,21,22)(H,23,24,25);;/q;2*+1/p-2/b18-17+;;

| InChIKey = CECHAJXICNIUQL-JLAJEUQUBK

| StdInChI_Ref = {{stdinchicite|correct|chemspider}}

| StdInChI = 1S/C16H12N2O7S2.2Na/c19-15-7-4-10-8-13(27(23,24)25)5-6-14(10)16(15)18-17-11-2-1-3-12(9-11)26(20,21)22;;/h1-9,19H,(H,20,21,22)(H,23,24,25);;/q;2*+1/p-2/b18-17+;;

| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}

| StdInChIKey = CECHAJXICNIUQL-QIKYXUGXSA-L

| CASNo_Ref = {{cascite|correct|??}}

| CASNo = 2347-72-0

| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}

| ChemSpiderID=20152418

| PubChem = 16868

| UNII = 35HF83708U

| DTXSID = DTXSID90893685

| SMILES = [Na+].[Na+].[O-]S(=O)(=O)c1cccc(c1)/N=N/c2c3ccc(cc3ccc2O)S([O-])(=O)=O

}}

| Section2 = {{Chembox Properties

| C=16

| H=10

| N=2

| Na=2

| O=7

| S=2

| Appearance =

| Density =

| MeltingPt =

| BoilingPt =

| Solubility =

}}

| Section3 = {{Chembox Hazards

| MainHazards =

| FlashPt =

| AutoignitionPt =

}}

}}

Orange GGN, also known as alpha-naphthol orange, is an azo dye{{cite web | url = https://www.scbt.com/scbt/product/orange-ggn-2347-72-0 | title = Orange GGN}} formerly used as a food dye. It is the disodium salt of 1-(m-sulfophenylazo)-2-naphthol-6-sulfonic acid. In Europe, it was denoted by the E Number E111, but has been forbidden for use in foods since 1 January 1978.EU directive 76/399/EEC It has never been included in the food additives list of the Codex Alimentarius. As such, it is forbidden for food use in general, because toxicological data has shown it is harmful.{{cn|date=December 2017}}

The absorption spectrum of Orange GGN and Sunset Yellow is nearly identical in visible and ultraviolet range, but they can be distinguished by their IR spectra.