Orchinol

{{Chembox

| ImageFile = Orchinol.svg

| ImageAlt = Chemical structure of orchinol

| PIN = 5,7-Dimethoxy-9,10-dihydrophenanthren-2-ol

| OtherNames = 9,10-Dihydro-5,7-dimethoxyphenanthren-2-ol

|Section1={{Chembox Identifiers

| CASNo = 41060-20-2

| CASNo_Ref = {{cascite|correct|CAS}}

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = V897GN013Q

| PubChem = 181686

| SMILES = COC1=CC(=C2C(=C1)CCC3=C2C=CC(=C3)O)OC

| ChemSpiderID = 158032

| InChI = 1/C16H16O3/c1-18-13-8-11-4-3-10-7-12(17)5-6-14(10)16(11)15(9-13)19-2/h5-9,17H,3-4H2,1-2H3

| InChIKey = HOVUVTNDNLNINP-UHFFFAOYAM

| StdInChI = 1S/C16H16O3/c1-18-13-8-11-4-3-10-7-12(17)5-6-14(10)16(11)15(9-13)19-2/h5-9,17H,3-4H2,1-2H3

| StdInChIKey = HOVUVTNDNLNINP-UHFFFAOYSA-N

}}

|Section2={{Chembox Properties

| C = 16 | H = 16 | O = 3

| Appearance =

| Density =

| MeltingPt =

| BoilingPt =

| Solubility =

}}

|Section3={{Chembox Hazards

| MainHazards =

| FlashPt =

| AutoignitionPt =

}}

}}

Orchinol is a 9,10-dihydrophenanthrene, a type of phenanthrenoid. It can be isolated from infected Orchis militaris and infected Loroglossum hircinumStructure of Orchinol, Loroglossol, and Hircinol. Roy M. Letcher and Llewellyn R. M. Nhamo, J. Chem. Soc., Perkin Trans. 1, 1973, pages 1263-1265, {{doi|10.1039/P19730001263}} with Rhizoctonia repens.Orchinol. Richard Braun, Moderne Methoden der Pflanzenanalyse, 1963, Volume 6, pages 130-134, {{doi|10.1007/978-3-642-94878-7_7}} (article in German) This molecule has a phytoalexin effect. It reduces the growth of Cattleya aurantiaca seedlingsEffects of Orchinol, Loroglossol, Dehydroorchinol, Batatasin III, and 3,4'- Dihydroxy-5-Methoxydihydrostilbene on Orchid Seedlings. Katherine A. Hills, Albert Stoessl, Allison P. Oliva and Joseph Arditti, Botanical Gazette, September 1984, Vol. 145, No. 3, pages 298-301 ([https://www.jstor.org/stable/2474721 link]) and has an antifungal activity.Structure and antifungal activity of hircinol, loroglossol and orchinol. M.H. Fisch, Brigitta H. Flick and J. Arditti, Phytochemistry, February 1973, Volume 12, Issue 2, Pages 437–441, {{doi|10.1016/0031-9422(73)80036-6}}