Oryzalin

{{Short description|Chemical compound}}

{{Drugbox

| Verifiedfields = changed

| Watchedfields = changed

| verifiedrevid = 431581830

| IUPAC_name = 4-(Dipropylamino)-3,5-dinitrobenzenesulfonamide

| image = Oryzalin.svg

| tradename =

| pregnancy_AU =

| pregnancy_US =

| pregnancy_category =

| legal_AU =

| legal_CA =

| legal_UK =

| legal_US =

| legal_status =

| routes_of_administration =

| bioavailability =

| protein_bound =

| metabolism =

| elimination_half-life =

| excretion =

| CAS_number_Ref = {{cascite|correct|??}}

| CAS_number = 19044-88-3

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = 662E385DWH

| ATC_prefix = none

| ATC_suffix =

| PubChem = 29393

| DrugBank_Ref = {{drugbankcite|correct|drugbank}}

| DrugBank =

| KEGG_Ref = {{keggcite|correct|kegg}}

| KEGG = C18877

| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}}

| ChemSpiderID = 27326

| C=12 | H=18 | N=4 | O=6 | S=1

| smiles = CCCN(CCC)c1c([N+](=O)[O-])cc(S(N)(=O)=O)cc1[N+](=O)[O-]

| StdInChI_Ref = {{stdinchicite|changed|chemspider}}

| StdInChI = 1S/C12H18N4O6S/c1-3-5-14(6-4-2)12-10(15(17)18)7-9(23(13,21)22)8-11(12)16(19)20/h7-8H,3-6H2,1-2H3,(H2,13,21,22)

| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}}

| StdInChIKey = UNAHYJYOSSSJHH-UHFFFAOYSA-N

| melting_point = 137

| melting_high = 139

}}

Oryzalin is a herbicide of the dinitroaniline class. It acts through the disruption (depolymerization) of microtubules, thus blocking anisotropic growth of plant cells.{{cite book | vauthors = Taiz L, Zeiger E |title=Plant Physiology | edition = 5th |date=2010 |publisher=Sinauer Associates |isbn=978-0-87893-866-7 |pages=433–434}} It can also be used to induce polyploidy in plants as an alternative to colchicine.{{cite journal | vauthors = Klíma M, Vyvadilová M, Kucera V | title = Chromosome doubling effects of selected antimitotic agents in Brassica napus microspore culture. | journal = Czech Journal of Genetics and Plant Breeding. | date = January 2008 | volume = 44 | issue = 1 | pages = 30–36 | doi = 10.17221/1328-CJGPB | url = http://www.agriculturejournals.cz/publicFiles/01063.pdf}}

References

{{Reflist}}