Osmium pentafluoride
{{Chembox
| ImageFile1 = PtF5solid.tif
| ImageFile2 = Unit_cell__of_OsF5.png
| ImageSize =
| ImageAlt =
| IUPACName =
| OtherNames =
| Section1 = {{Chembox Identifiers
| CASNo = 31576-40-6
| ChemSpiderID = 103874289
| PubChem = 15797581
| StdInChI=1S/5FH.Os/h5*1H;/q;;;;;+5/p-5
| StdInChIKey = RFWLPKSDISVSGM-UHFFFAOYSA-I
| SMILES = F[Os](F)(F)(F)F
| SMILES_Comment = monomer
| SMILES1 = F[Os-]1(F)(F)(F)[F+][Os-](F)(F)(F)(F)[F+][Os-](F)(F)(F)(F)[F+][Os-](F)(F)(F)(F)[F+]1
| SMILES1_Comment = tetramer
}}
| Section2 = {{Chembox Properties
| Os=1|F=5
| MolarMass =
| Appearance = blue-green solid
| Density =
| MeltingPtC = 70
| BoilingPt =
| Solubility = }}
| Section3 = {{Chembox Hazards
| MainHazards =
| FlashPt =
| AutoignitionPt = }}
}}
Osmium pentafluoride is an inorganic compound with the formula OsF5. It is a blue-green solid. Like the pentafluorides of Ru, Rh, and Ir, OsF5 exists as a tetramer in the solid state.
Preparation
Osmium pentafluoride can be prepared by reduction of osmium hexafluoride with iodine as a solution in iodine pentafluoride:{{cite journal| author = Holloway, John H.| author2 = Mitchell, S. J. | title= Preparation and Crystal Structure of Osmium Pentafluoride| journal= Journal of the Chemical Society | year= 1971|pages=2789–94|doi=10.1039/J19710002789}}
:10 OsF6 + I2 → 10 OsF5 + 2 IF5
References
{{Reflist}}
{{Osmium compounds}}
{{fluorine compounds}}