Osthol

{{chembox

| Verifiedfields = changed

| verifiedrevid = 462266252

| ImageFile = Osthol.svg

| ImageSize =

| PIN = 7-Methoxy-8-(3-methylbut-2-en-1-yl)-2H-1-benzopyran-2-one

| OtherNames = Osthole

|Section1={{Chembox Identifiers

| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}

| ChemSpiderID = 9811

| KEGG_Ref = {{keggcite|correct|kegg}}

| KEGG = C09280

| InChI = 1/C15H16O3/c1-10(2)4-7-12-13(17-3)8-5-11-6-9-14(16)18-15(11)12/h4-6,8-9H,7H2,1-3H3

| InChIKey = MBRLOUHOWLUMFF-UHFFFAOYAW

| ChEMBL_Ref = {{ebicite|correct|EBI}}

| ChEMBL = 52229

| StdInChI_Ref = {{stdinchicite|correct|chemspider}}

| StdInChI = 1S/C15H16O3/c1-10(2)4-7-12-13(17-3)8-5-11-6-9-14(16)18-15(11)12/h4-6,8-9H,7H2,1-3H3

| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}

| StdInChIKey = MBRLOUHOWLUMFF-UHFFFAOYSA-N

| CASNo_Ref = {{cascite|changed|??}}

| CASNo = 484-12-8

| PubChem = 10228

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = XH1TI1759C

| SMILES = O=C/2Oc1c(c(OC)ccc1\C=C\2)C\C=C(/C)C

}}

|Section2={{Chembox Properties

| C=15

| H=16

| O=3

| Appearance=

| Density=

| MeltingPt=

| BoilingPt=

| Solubility=

}}

|Section3={{Chembox Hazards

| MainHazards=

| FlashPt=

| AutoignitionPt =

}}

}}

Osthol, or osthole, is a chemical compound which is a derivative of coumarin.{{Cite journal | doi = 10.1155/2015/919616| title = Osthole: A Review on Its Bioactivities, Pharmacological Properties, and Potential as Alternative Medicine| journal = Evidence-Based Complementary and Alternative Medicine| volume = 2015| pages = 1–10| year = 2015| last1 = Zhang| first1 = Zhong-Rong| last2 = Leung| first2 = Wing Nang| last3 = Cheung| first3 = Ho Yee| last4 = Chan| first4 = Chun Wai| pmc = 4515521| pmid=26246843| doi-access = free}} It is found in a variety of plants including Cnidium monnieri, Angelica archangelica and Angelica pubescens.