Oxabolone cipionate

{{Short description|Chemical compound}}

{{Drugbox

| Verifiedfields = changed

| Watchedfields = changed

| verifiedrevid = 408354515

| IUPAC_name = [(8R,9S,10R,13S,14S,17S)-4-hydroxy-13-methyl-3-oxo-2,6,7,8,9,10,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]-3-cyclopentylpropanoate

| image = Oxabolone cipionate.svg

| width = 250px

| tradename = Steranabol Depo, Steranabol Ritardo

| pregnancy_category =

| legal_status =

| routes_of_administration = Intramuscular injection

| class = Androgen; Anabolic steroid; Androgen ester

| bioavailability =

| protein_bound =

| metabolism =

| elimination_half-life =

| excretion =

| CAS_number_Ref = {{cascite|correct|??}}

| CAS_number = 1254-35-9

| ATC_prefix = A14

| ATC_suffix = AB03

| PubChem = 68952

| DrugBank_Ref = {{drugbankcite|correct|drugbank}}

| DrugBank = DB13185

| UNII_Ref = {{fdacite|changed|FDA}}

| UNII = 5RXY50Q01N

| KEGG_Ref = {{keggcite|correct|kegg}}

| KEGG = D01149

| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}}

| ChemSpiderID = 62175

| ChEBI = 31940

| ChEMBL = 2105318

| synonyms = Oxabolone cypionate; FI-5852; 4-Hydroxy-19-nortestosterone 17β-cypionate; Estr-4-en-4,17β-diol-3-one 17β-cypionate

| C=26 | H=38 | O=4

| SMILES = C[C@]12CC[C@H]3[C@H]([C@@H]1CC[C@@H]2OC(=O)CCC4CCCC4)CCC5=C(C(=O)CC[C@H]35)O

| StdInChI_Ref = {{stdinchicite|changed|chemspider}}

| StdInChI = 1S/C26H38O4/c1-26-15-14-18-17-9-11-22(27)25(29)20(17)8-7-19(18)21(26)10-12-23(26)30-24(28)13-6-16-4-2-3-5-16/h16-19,21,23,29H,2-15H2,1H3/t17-,18-,19-,21+,23+,26+/m1/s1

| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}}

| StdInChIKey = KHKDIUPVDIEHAH-KXLSUQFWSA-N

}}

Oxabolone cipionate ({{abbrlink|INN|International Nonproprietary Name}}, {{abbrlink|JAN|Japanese Accepted Name}}) (brand names Steranabol Depo, Steranabol Ritardo; former developmental code name FI-5852), or oxabolone cypionate, also known as 4-hydroxy-19-nortestosterone 17β-cypionate or estr-4-en-4,17β-diol-3-one 17β-cypionate, is synthetic and injected anabolic–androgenic steroid (AAS) and derivative of nandrolone (19-nortestosterone) which has been marketed in Europe.{{cite book| vauthors = Krüskemper HL |title=Anabolic Steroids|url=https://books.google.com/books?id=4xIlBQAAQBAJ&pg=PA203|date=22 October 2013|publisher=Elsevier|isbn=978-1-4832-6504-9|pages=203–}}{{cite book|title=Index Nominum 2000: International Drug Directory|url=https://books.google.com/books?id=5GpcTQD_L2oC&pg=PA764|date=January 2000|publisher=Taylor & Francis|isbn=978-3-88763-075-1|pages=764–765}}{{cite book| vauthors = Elks J |title=The Dictionary of Drugs: Chemical Data: Chemical Data, Structures and Bibliographies|url=https://books.google.com/books?id=0vXTBwAAQBAJ&pg=RA1-PA538|date=14 November 2014|publisher=Springer|isbn=978-1-4757-2085-3|pages=1–}} It is the C17β cypionate ester and a prodrug of oxabolone (4-hydroxy-19-nortestosterone).