Oxaceprol

{{Short description|Chemical compound}}

{{Drugbox

| verifiedrevid = 447917039

| IUPAC_name = (4R)-1-acetyl-4-hydroxy-L-proline

| image = Oxaceprol.svg

| image_class = skin-invert-image

| width = 200px

| tradename =

| Drugs.com = {{drugs.com|international|oxaceprol}}

| pregnancy_AU =

| pregnancy_US =

| pregnancy_category =

| legal_AU =

| legal_CA =

| legal_UK =

| legal_US =

| legal_status =

| routes_of_administration =

| bioavailability =

| protein_bound =

| metabolism =

| elimination_half-life =

| excretion =

| CAS_number_Ref = {{cascite|correct|??}}

| CAS_number = 33996-33-7

| ATC_prefix = D11

| ATC_suffix = AX09

| ATC_supplemental = {{ATC|M01|AX24}}

| PubChem = 65784

| DrugBank_Ref = {{drugbankcite|correct|drugbank}}

| DrugBank =

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = Q0XV76B96L

| KEGG_Ref = {{keggcite|correct|kegg}}

| KEGG = D07215

| ChemSpiderID = 59203

| ChEMBL = 1407356

| ChEBI = 233149

| C=7 | H=11 | N=1 | O=4

| smiles = CC(=O)N1C[C@@H](C[C@H]1C(=O)O)O

| StdInChI = 1S/C7H11NO4/c1-4(9)8-3-5(10)2-6(8)7(11)12/h5-6,10H,2-3H2,1H3,(H,11,12)/t5-,6+/m1/s1

| StdInChIKey = BAPRUDZDYCKSOQ-RITPCOANSA-N

| synonyms = (2S,4R)-1-acetyl-4-hydroxypyrrolidine-2-carboxylic acid

}}

Oxaceprol is an anti-inflammatory drug used in the treatment of osteoarthritis.{{cite journal | vauthors = Herrmann G, Steeger D, Klasser M, Wirbitzky J, Fürst M, Venbrocks R, Rohde H, Jungmichel D, Hildebrandt HD, Parnham MJ, Gimbel W, Dirschedl H | display-authors = 6 | title = Oxaceprol is a well-tolerated therapy for osteoarthritis with efficacy equivalent to diclofenac | journal = Clinical Rheumatology | volume = 19 | issue = 2 | pages = 99–104 | year = 2000 | pmid = 10791619 | doi = 10.1007/s100670050025 | s2cid = 25654850 }} It is derived from L-proline, a DNA-encoded amino acid. The active effect of Oxaceprol is to inhibit the adhesion and migration of white blood cells.