Oxaline

{{For|the short for glyoxaline|Imidazole}}

{{Chembox

| ImageFile = Oxaline.svg

| ImageSize =

| ImageAlt =

| IUPACName =

| OtherNames =

|Section1={{Chembox Identifiers

| CASNo = 55623-37-5

| CASNo_Ref = {{Cascite|changed|CAS}}

| PubChem = 6438440

| ChEBI = 70400

| ChemSpiderID = 10225680

| SMILES = CC(C)(C=C)[C@]12C=C(C(=O)N\3[C@@]1(NC(=O)/C3=C\c4c[nH]cn4)N(c5c2cccc5)OC)OC

| InChI = 1/C24H25N5O4/c1-6-22(2,3)23-12-19(32-4)21(31)28-18(11-15-13-25-14-26-15)20(30)27-24(23,28)29(33-5)17-10-8-7-9-16(17)23/h6-14H,1H2,2-5H3,(H,25,26)(H,27,30)/b18-11+/t23-,24-/m1/s1

| InChIKey = SOHAVULMGIITDH-SSDCDQDPBU

| StdInChI = 1S/C24H25N5O4/c1-6-22(2,3)23-12-19(32-4)21(31)28-18(11-15-13-25-14-26-15)20(30)27-24(23,28)29(33-5)17-10-8-7-9-16(17)23/h6-14H,1H2,2-5H3,(H,25,26)(H,27,30)/b18-11+/t23-,24-/m1/s1

| StdInChIKey = SOHAVULMGIITDH-SSDCDQDPSA-N

}}

|Section2={{Chembox Properties

| C=24 | H=25 | N=5 | O=4

| Appearance =

| Density =

| MeltingPt =

| BoilingPt =

| Solubility = }}

|Section3={{Chembox Hazards

| MainHazards =

| FlashPt =

| AutoignitionPt = }}

}}

Oxaline is a fungal isolate with anticancer activity in vitro.{{cite journal | pmid = 15276324 | title = Oxaline, a fungal alkaloid, arrests the cell cycle in M phase by inhibition of tubulin polymerization | year = 2004 | last1 = Koizumi | first1 = Y | last2 = Arai | first2 = M | last3 = Tomoda | first3 = H | last4 = Omura | first4 = S | journal = Biochimica et Biophysica Acta (BBA) - Molecular Cell Research | volume = 1693 | issue = 1 | pages = 47–55 | doi = 10.1016/j.bbamcr.2004.04.013 | doi-access = free }} It is an O-methylated derivative of meleagrin.