Oxotremorine

{{Short description|Chemical compound}}

{{Drugbox

| Verifiedfields = changed

| Watchedfields = changed

| verifiedrevid = 383299199

| IUPAC_name = 1-(4-Pyrrolidin-1-ylbut-2-yn-1-yl)pyrrolidin-2-one

| image = Oxotremorine.svg

| width = 200

| tradename =

| pregnancy_US =

| pregnancy_category = C

| legal_AU =

| legal_CA =

| legal_UK =

| legal_US_comment = Experimental/not yet approved

| routes_of_administration = Oral, intravenous

| bioavailability =

| protein_bound =

| metabolism =

| elimination_half-life =

| excretion =

| CAS_number_Ref = {{cascite|correct|??}}

| CAS_number = 70-22-4

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = 5RY0UWH1JL

| ATC_prefix = none

| ATC_suffix =

| PubChem =

| IUPHAR_ligand = 302

| DrugBank_Ref = {{drugbankcite|correct|drugbank}}

| DrugBank =

| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}}

| ChemSpiderID = 4469

| KEGG =

| ChEMBL_Ref = {{ebicite|changed|EBI}}

| ChEMBL = 7634

| C=12 | H=18 | N=2 | O=1

| smiles = C1CCN(C1)CC#CCN2CCCC2=O

| StdInChI_Ref = {{stdinchicite|changed|chemspider}}

| StdInChI = InChI=1S/C12H18N2O/c15-12-6-5-11-14(12)10-4-3-9-13-7-1-2-8-13/h1-2,5-11H2

| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}}

| StdInChI_comment =

| StdInChIKey = RSDOPYMFZBJHRL-UHFFFAOYSA-N

| density =

| melting_point =

| melting_high =

| melting_notes =

| boiling_point =

| boiling_notes =

| solubility =

| specific_rotation =

| sec_combustion =

}}

Oxotremorine is a drug that acts as a selective muscarinic acetylcholine receptor agonist.{{cite journal | vauthors = Tang C, Castoldi AF, Costa LG | title = Effects of the muscarinic agonist oxotremorine on membrane fluidity in rat lymphocytes | journal = Biochemistry and Molecular Biology International | volume = 29 | issue = 6 | pages = 1047–54 | date = April 1993 | pmid = 8330013 | id = {{INIST|4025194}} }}

Oxotremorine produces ataxia, tremor and spasticity, similar to those symptoms seen in Parkinsonism, and has thus become a research tool in experimental studies aimed at determining more effective anti-Parkinsonian drugs.{{cite book | veditors = Craig CR, Stitzel RE |title=Modern Pharmacology with Clinical Applications |date=2004 |publisher=Lippincott Williams & Wilkins |isbn=978-0-7817-3762-3 }}{{pn|date=January 2021}}

Oxotremorine also produces antipsychotic-like effects.{{cite journal | vauthors = Maehara S, Hikichi H, Satow A, Okuda S, Ohta H | title = Antipsychotic property of a muscarinic receptor agonist in animal models for schizophrenia | journal = Pharmacology, Biochemistry, and Behavior | volume = 91 | issue = 1 | pages = 140–9 | date = November 2008 | pmid = 18651995 | doi = 10.1016/j.pbb.2008.06.023 | s2cid = 12225821 | id = {{INIST|20678587}} }}