Oxprenoate potassium

{{Short description|Chemical compound}}

{{Drugbox

| Verifiedfields =

| Watchedfields =

| verifiedrevid =

| IUPAC_name = potassium 3-[(7R,8R,9S,10R,13S,14S,17R)-17-Hydroxy-10,13-dimethyl-3-oxo-7-propyl-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-17-yl]propanoate

| image = Oxprenoate potassium.svg

| width =

| tradename =

| pregnancy_AU =

| pregnancy_US =

| pregnancy_category =

| legal_AU =

| legal_CA =

| legal_UK =

| legal_US =

| legal_status =

| routes_of_administration =

| bioavailability =

| protein_bound =

| metabolism =

| elimination_half-life =

| excretion =

| CAS_number_Ref =

| CAS_number = 76676-34-1

| CAS_supplemental =

| class = Antimineralocorticoid

| ATC_prefix =

| ATC_suffix =

| ATC_supplemental =

| PubChem = 23677972

| IUPHAR_ligand =

| DrugBank_Ref =

| DrugBank =

| ChemSpiderID_Ref =

| ChemSpiderID = 64295

| UNII = 167NDD8MTE

| KEGG =

| ChEBI =

| ChEMBL =

| C=25 | H=37 | K=1 | O=4

| SMILES = CCC[C@@H]1CC2=CC(=O)CC[C@@]2([C@@H]3[C@@H]1[C@@H]4CC[C@]([C@]4(CC3)C)(CCC(=O)[O-])O)C.[K+]

| StdInChI_Ref =

| StdInChI = 1S/C25H38O4.K/c1-4-5-16-14-17-15-18(26)6-10-23(17,2)19-7-11-24(3)20(22(16)19)8-12-25(24,29)13-9-21(27)28;/h15-16,19-20,22,29H,4-14H2,1-3H3,(H,27,28);/q;+1/p-1/t16-,19+,20+,22-,23+,24+,25-;/m1./s1

| StdInChIKey_Ref =

| StdInChIKey = HXJITUGMCJCKCE-UYOQDFFISA-M

| synonyms = RU-28318; 17α-Hydroxy-3-oxo-7α-propylpregn-4-ene-21-carboxylic acid monopotassium salt

}}

Oxprenoate potassium (developmental code name RU-28318) is a synthetic steroidal antimineralocorticoid which was never marketed.{{cite book|author=J. Elks|title=The Dictionary of Drugs: Chemical Data: Chemical Data, Structures and Bibliographies|url=https://books.google.com/books?id=0vXTBwAAQBAJ&pg=PA922|date=14 November 2014|publisher=Springer|isbn=978-1-4757-2085-3|pages=922–}} The affinities of oxprenoate potassium for the steroid hormone receptors have been reported.{{cite book| vauthors = Raynaud JP, Fortin M, Hunt P, Ojasoo T, Doré JC, Surcouf E, Mornon JP | veditors = Gotto AM, O'Malley BW | collaboration = Fondation Princesse Liliane |chapter=Approaches to drug development using receptors|title=The Role of Receptors in Biology and Medicine: Proceedings of the Ninth Argenteuil Symposium|url=https://books.google.com/books?id=ORFrAAAAMAAJ|year=1986|publisher=Raven Press|isbn=978-0-88167-161-2|pages=65–77}}