P1-185
{{Short description|Chemical compound}}
{{Drugbox
| Verifiedfields =
| Watchedfields =
| verifiedrevid =
| IUPAC_name = [(E)-[(8S,9S,10R,13S,14S,17S)-17-acetyl-10,13-dimethyl-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-ylidene]amino] (2S)-2-amino-3-methylbutanoate
| image = P1-185.svg
| width = 250px
| tradename =
| pregnancy_AU =
| pregnancy_US =
| pregnancy_category =
| legal_AU =
| legal_CA =
| legal_UK =
| legal_US =
| legal_status =
| routes_of_administration =
| class = Progestogen; Neurosteroid
| bioavailability =
| protein_bound =
| metabolism =
| elimination_half-life =
| excretion =
| CAS_number_Ref =
| CAS_number = 1185297-01-1
| CAS_supplemental =
| ATC_prefix =
| ATC_suffix =
| ATC_supplemental =
| PubChem = 44219330
| IUPHAR_ligand =
| DrugBank_Ref =
| DrugBank =
| ChemSpiderID_Ref =
| ChemSpiderID = 25052147
| UNII =
| KEGG =
| ChEBI =
| ChEMBL = 565873
| C=26 | H=40 | N=2 | O=3
| SMILES = CC(C)[C@@H](C(=O)O/N=C/1\CC[C@@]2([C@H]3CC[C@]4([C@H]([C@@H]3CCC2=C1)CC[C@@H]4C(=O)C)C)C)N
| StdInChI_Ref =
| StdInChI = 1S/C26H40N2O3/c1-15(2)23(27)24(30)31-28-18-10-12-25(4)17(14-18)6-7-19-21-9-8-20(16(3)29)26(21,5)13-11-22(19)25/h14-15,19-23H,6-13,27H2,1-5H3/b28-18+/t19-,20+,21-,22-,23-,25-,26+/m0/s
| StdInChIKey_Ref =
| StdInChIKey = JFIPYWOCXPCAFX-NPRMJFGVSA-N
| synonyms = (3E)-3-({[(2S)-2-Amino-3-methylbutanoyl]oxy}imino)pregn-4-en-20-one
}}
P1-185, also known as progesterone 3-O-(L-valine)-E-oxime or as pregn-4-ene-3,20-dione 3-O-(L-valine)-E-oxime, is a synthetic progestogen and neurosteroid and an oxime ester analogue and prodrug of progesterone (and by extension of allopregnanolone).{{cite journal | vauthors = MacNevin CJ, Atif F, Sayeed I, Stein DG, Liotta DC | title = Development and screening of water-soluble analogues of progesterone and allopregnanolone in models of brain injury | journal = J. Med. Chem. | volume = 52 | issue = 19 | pages = 6012–23 | year = 2009 | pmid = 19791804 | doi = 10.1021/jm900712n }}{{cite journal | vauthors = Guthrie DB, Stein DG, Liotta DC, Lockwood MA, Sayeed I, Atif F, Arrendale RF, Reddy GP, Evers TJ, Marengo JR, Howard RB, Culver DG, Natchus MG | title = Water-soluble progesterone analogues are effective, injectable treatments in animal models of traumatic brain injury | journal = ACS Med Chem Lett | volume = 3 | issue = 5 | pages = 362–6 | year = 2012 | pmid = 24900479 | pmc = 4025794 | doi = 10.1021/ml200303r }} It was developed as an improved water-soluble version of progesterone such that it could be formulated as an aqueous preparation and easily and rapidly administered intravenously as a potential therapy for traumatic brain injury. However, the chemical synthesis of P1-185 was described as somewhat challenging, so oxime conjugates of progesterone of the C20 instead of C3 position, such as EIDD-1723 and EIDD-036, have since been developed.{{cite journal | vauthors = Wali B, Sayeed I, Guthrie DB, Natchus MG, Turan N, Liotta DC, Stein DG | title = Evaluating the neurotherapeutic potential of a water-soluble progesterone analog after traumatic brain injury in rats | journal = Neuropharmacology | volume = 109 | pages = 148–158 | date = October 2016 | pmid = 27267687 | doi = 10.1016/j.neuropharm.2016.05.017 | s2cid = 19906601 }}Guthrie, D. B., Lockwood, M. A., Natchus, M. G., Liotta, D. C., Stein, D. G., & Sayeed, I. (2017). U.S. Patent No. 9,802,978. Washington, DC: U.S. Patent and Trademark Office. https://patents.google.com/patent/US9802978B2/en
See also
References
{{Reflist}}
External links
- {{Commonscatinline}}
{{GABAA receptor positive allosteric modulators}}
{{Progesterone receptor modulators}}
Category:GABAA receptor positive allosteric modulators
Category:Neuroprotective agents
{{Steroid-stub}}
{{Genito-urinary-drug-stub}}