PD-128,907

{{Short description|Chemical compound}}

{{Drugbox

| Verifiedfields = changed

| verifiedrevid = 451226356

| IUPAC_name = (4aR,10bR)-3,4a,4,10b-Tetrahydro-4-propyl-2H,5H-[1]benzopyrano-[4,3-b]-1,4-oxazin-9-ol

| image = PD-128,907 Structure.svg

| width =

| tradename =

| pregnancy_AU =

| pregnancy_US =

| pregnancy_category =

| legal_AU =

| legal_UK =

| legal_US =

| legal_status =

| routes_of_administration =

| bioavailability =

| protein_bound =

| metabolism =

| elimination_half-life =

| excretion =

| CAS_number_Ref = {{cascite|correct|??}}

| CAS_number = 123594-64-9

| CAS_supplemental =
300576-59-4 (hydrochloride)

| ATC_prefix =

| ATC_suffix =

| PubChem = 5311346

| ChEMBL_Ref = {{ebicite|changed|EBI}}

| ChEMBL = 94015

| DrugBank_Ref = {{drugbankcite|correct|drugbank}}

| DrugBank =

| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}}

| ChemSpiderID = 23180492

| C=14 | H=19 | N=1 | O=3

| smiles = CCCN1CCO[C@H]2[C@H]1COC3=C2C=C(C=C3)O

| StdInChI_Ref = {{stdinchicite|changed|chemspider}}

| StdInChI = 1S/C14H19NO3/c1-2-5-15-9-17-7-12-11-6-10(16)3-4-14(11)18-8-13(12)15/h3-4,6,12-13,16H,2,5,7-9H2,1H3/t12-,13-/m1/s1

| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}}

| StdInChIKey = ZFSOBPVEIKTNQS-CHWSQXEVSA-N

}}

PD-128,907 is a drug used in scientific research which acts as a potent and selective agonist for the dopamine D₂ and D₃ receptors.{{cite journal | vauthors = DeWald HA, Heffner TG, Jaen JC, Lustgarten DM, McPhail AT, Meltzer LT, Pugsley TA, Wise LD | display-authors = 6 | title = Synthesis and dopamine agonist properties of (+-)-trans-3,4,4a,10b-tetrahydro-4-propyl-2H,5H-[1]benzopyrano [4,3-b]-1,4-oxazin-9-ol and its enantiomers | journal = Journal of Medicinal Chemistry | volume = 33 | issue = 1 | pages = 445–50 | date = January 1990 | pmid = 1967318 | doi = 10.1021/jm00163a068 }} It is used for studying the role of these receptors in the brain, in roles such as inhibitory autoreceptors that act to limit further dopamine release,{{cite journal | vauthors = Koeltzow TE, Xu M, Cooper DC, Hu XT, Tonegawa S, Wolf ME, White FJ | title = Alterations in dopamine release but not dopamine autoreceptor function in dopamine D3 receptor mutant mice | journal = The Journal of Neuroscience | volume = 18 | issue = 6 | pages = 2231–8 | date = March 1998 | doi = 10.1523/JNEUROSCI.18-06-02231.1998 | pmid = 9482807 | pmc = 6792939 }} as well as release of other neurotransmitters.{{cite journal | vauthors = Chen G, Kittler JT, Moss SJ, Yan Z | title = Dopamine D3 receptors regulate GABAA receptor function through a phospho-dependent endocytosis mechanism in nucleus accumbens | journal = The Journal of Neuroscience | volume = 26 | issue = 9 | pages = 2513–21 | date = March 2006 | pmid = 16510729 | pmc=6793654 | doi = 10.1523/JNEUROSCI.4712-05.2006 | doi-access = free }} In animal studies, it has been shown to reduce toxicity from cocaine overdose.{{cite journal | vauthors = Witkin JM, Dijkstra D, Levant B, Akunne HC, Zapata A, Peters S, Shannon HE, Gasior M | display-authors = 6 | title = Protection against cocaine toxicity in mice by the dopamine D3/D2 agonist R-(+)-trans-3,4a,10b-tetrahydro-4-propyl-2H,5H-[1]benzopyrano[4,3-b]-1,4-oxazin-9-ol [(+)-PD 128,907] | journal = The Journal of Pharmacology and Experimental Therapeutics | volume = 308 | issue = 3 | pages = 957–64 | date = March 2004 | pmid = 14711932 | doi = 10.1124/jpet.103.059980 }}{{cite journal | vauthors = Witkin JM, Levant B, Zapata A, Kaminski R, Gasior M | title = The dopamine D3/D2 agonist (+)-PD-128,907 [(R-(+)-trans-3,4a,10b-tetrahydro-4-propyl-2H,5H-[1]benzopyrano[4,3-b]-1,4-oxazin-9-ol)] protects against acute and cocaine-kindled seizures in mice: further evidence for the involvement of D3 receptors | journal = The Journal of Pharmacology and Experimental Therapeutics | volume = 326 | issue = 3 | pages = 930–8 | date = September 2008 | pmid = 18566292 | doi = 10.1124/jpet.108.139212 }}