PF-03550096
{{Short description|Chemical compound}}
{{Drugbox
| IUPAC_name = N-[(1S)-1-(aminocarbonyl)-2,2-dimethylpropyl]-2,3-dihydro-3-(3-hydroxy-3-methylbutyl)-2-oxo-1H-benzimidazole-1-carboxamide
| image = PF-03550096.svg
| image_class = skin-invert-image
| tradename =
| pregnancy_AU =
| pregnancy_US =
| pregnancy_category =
| legal_AU =
| legal_CA =
| legal_UK =
| legal_US =
| legal_status =
| routes_of_administration =
| bioavailability =
| protein_bound =
| metabolism =
| elimination_half-life =
| excretion =
| CAS_number_Ref = {{cascite|correct|CAS}}
| CAS_number = 910376-39-5
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = E8S33VNW75
| ATC_prefix =
| ATC_suffix =
| PubChem = 24857887
| smiles = O=C(N1C(N(CCC(C)(O)C)C2=C1C=CC=C2)=O)N[C@@H](C(C)(C)C)C(N)=O
| StdInChI = 1S/C19H28N4O4/c1-18(2,3)14(15(20)24)21-16(25)23-13-9-7-6-8-12(13)22(17(23)26)11-10-19(4,5)27/h6-9,14,27H,10-11H2,1-5H3,(H2,20,24)(H,21,25)/t14-/m1/s1
| StdInChIKey = GGNIFXBIJCNXCT-CQSZACIVSA-N
| ChemSpiderID = 21378519
| C=19 | H=28 | N=4 | O=4
}}
PF-03550096 is a drug that acts as a potent agonist for the CB2 cannabinoid receptor, with good selectivity over CB1 having Ki values of 7nM at CB2 and 1500nM at CB1. It was originally developed by Pfizer in 2008 as a medication for irritable bowel syndrome,{{cite patent | country = WO | number = 2008032164 | pubdate = 20 March 2008 | url = http://patentscope.wipo.int/search/en/detail.jsf?docId=WO2008032164 | inventor = Ando K, et al | assign1 = Pfizer Products Inc. | title = Benzimidazolone Derivatives }} but has only progressed to animal studies.{{cite journal | vauthors = Kikuchi A, Ohashi K, Sugie Y, Sugimoto H, Omura H | title = Pharmacological evaluation of a novel cannabinoid 2 (CB2) ligand, PF-03550096, in vitro and in vivo by using a rat model of visceral hypersensitivity | journal = Journal of Pharmacological Sciences | volume = 106 | issue = 2 | pages = 219–24 | date = February 2008 | pmid = 18270474 | doi = 10.1254/jphs.FP0071599 | doi-access = free }}