PF-05089771
{{Short description|Investigational analgesic drug}}
{{Infobox drug
| IUPAC_name = 4-[2-(3-Amino-1H-pyrazol-4-yl)-4-chlorophenoxy]-5-chloro-2-fluoro-N-(1,3-thiazol-4-yl)benzene-1-sulfonamide
| image = PF-05089771.svg
| image_class = skin-invert-image
| legal_AU =
| legal_CA =
| legal_DE =
| legal_UK =
| legal_US = Investigational New Drug
| legal_status =
| IUPHAR_ligand =
| CAS_number = 1235403-62-9
| ATC_prefix =
| ATC_suffix =
| PubChem = 46840946
| DrugBank =
| ChemSpiderID = 29411106
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = 25U4N985O2
| ChEMBL = 2325014
| C = 18 | H = 12 | Cl = 2 | F = 1 | N = 5 | O = 3 | S = 2
| molecular_weight =
| smiles = C1=CC(=C(C=C1Cl)C2=C(NN=C2)N)OC3=CC(=C(C=C3Cl)S(=O)(=O)NC4=CSC=N4)F
| StdInChI = 1S/C18H12Cl2FN5O3S2/c19-9-1-2-14(10(3-9)11-6-24-25-18(11)22)29-15-5-13(21)16(4-12(15)20)31(27,28)26-17-7-30-8-23-17/h1-8,26H,(H3,22,24,25)
| StdInChIKey = ZYSCOUXLBXGGIM-UHFFFAOYSA-N
}}
PF-05089771 is a selective, small-molecule Nav1.7 and Nav1.8 voltage-gated sodium channel blocker under development by Pfizer as a novel analgesic.{{cite book | vauthors = McMahon SB, Koltzenburg M, Tracey I, Turk D |author3-link=Irene Tracey |title=Wall & Melzack's Textbook of Pain|url=https://books.google.com/books?id=ok0_jIJ0w_wC&pg=PA508 |publisher=Elsevier Health Sciences |date=March 2013 |page=508 |isbn=978-0702053740}}{{cite journal| vauthors = Martz L |title=Nav-i-gating antibodies for pain|journal=SciBX: Science-Business EXchange|date=June 2014|volume=7|issue=23|pages=662|doi=10.1038/scibx.2014.662|doi-access=free}}{{cite journal | vauthors = Alexandrou AJ, Brown AR, Chapman ML, Estacion M, Turner J, Mis MA, Wilbrey A, Payne EC, Gutteridge A, Cox PJ, Doyle R, Printzenhoff D, Lin Z, Marron BE, West C, Swain NA, Storer RI, Stupple PA, Castle NA, Hounshell JA, Rivara M, Randall A, Dib-Hajj SD, Krafte D, Waxman SG, Patel MK, Butt RP, Stevens EB | display-authors = 6 | title = Subtype-Selective Small Molecule Inhibitors Reveal a Fundamental Role for Nav1.7 in Nociceptor Electrogenesis, Axonal Conduction and Presynaptic Release | journal = PLOS ONE | volume = 11 | issue = 4 | pages = e0152405 | date = 6 April 2016 | pmid = 27050761 | pmc = 4822888 | doi = 10.1371/journal.pone.0152405 | doi-access = free | bibcode = 2016PLoSO..1152405A }} As of June 2014, it has completed phase II clinical trials for wisdom tooth removal and primary erythromelalgia.{{cite journal | vauthors = Bagal SK, Chapman ML, Marron BE, Prime R, Storer RI, Swain NA | title = Recent progress in sodium channel modulators for pain | journal = Bioorganic & Medicinal Chemistry Letters | volume = 24 | issue = 16 | pages = 3690–3699 | date = August 2014 | pmid = 25060923 | doi = 10.1016/j.bmcl.2014.06.038 | doi-access = free }}
See also
References
{{Reflist}}
External links
- {{cite web | url = http://adisinsight.springer.com/drugs/800026875 | title = PF-05089771 | work = AdisInsight | publisher = Springer Nature Switzerland AG }}
{{Analgesics}}
{{Ion channel modulators}}
Category:Sodium channel blockers
Category:Fluorobenzene derivatives
Category:Chlorobenzene derivatives
Category:Drugs developed by Pfizer
{{analgesic-stub}}