PHTPP

{{Short description|Chemical compound}}

{{Drugbox

| Verifiedfields =

| Watchedfields =

| verifiedrevid =

| IUPAC_name = 4-[2-Phenyl-5,7-bis(trifluoromethyl)pyrazolo[1,5-a]pyrimidin-3-yl]phenol

| image = PHTPP structure.svg

| width =

| tradename =

| pregnancy_AU =

| pregnancy_US =

| pregnancy_category =

| legal_AU =

| legal_CA =

| legal_UK =

| legal_US =

| legal_status =

| routes_of_administration =

| bioavailability =

| protein_bound =

| metabolism =

| elimination_half-life =

| excretion =

| CAS_number_Ref = {{cascite|correct|CAS}}

| CAS_number = 805239-56-9

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = NN82CVN36N

| CAS_supplemental =

| ATC_prefix =

| ATC_suffix =

| PubChem = 11201035

| DrugBank_Ref =

| DrugBank =

| ChemSpiderID_Ref =

| ChemSpiderID = 9376104

| C=20 | H=11 | F=6 | N=3 | O=1

| smiles = C1=CC=C(C=C1)C2=NN3C(=CC(=NC3=C2C4=CC=C(C=C4)O)C(F)(F)F)C(F)(F)F

| StdInChI = 1S/C20H11F6N3O/c21-19(22,23)14-10-15(20(24,25)26)29-18(27-14)16(11-6-8-13(30)9-7-11)17(28-29)12-4-2-1-3-5-12/h1-10,30H

| StdInChIKey = AEZPAUSGTAHLOQ-UHFFFAOYSA-N

| synonyms =

}}

PHTPP is a synthetic, nonsteroidal, and highly selective antagonist of ERβ that is used in scientific research to study the function of this receptor.{{cite book|title=Neurosteroids|url=https://books.google.com/books?id=fSgNRlZUwt0C&pg=PA95|publisher=Frontiers E-books|isbn=978-2-88919-078-2|pages=95–}}{{cite book|title=Cytoplasmic and Nuclear Receptors—Advances in Research and Application: 2012 Edition|url=https://books.google.com/books?id=AH0i2PG-MjsC&pg=PT220|date=26 December 2012|publisher=ScholarlyEditions|isbn=978-1-4649-9741-9|pages=220–}} It possesses 36-fold selectivity for ERβ over ERα, and is a silent antagonist of ERβ.{{cite journal | vauthors = Compton DR, Sheng S, Carlson KE, Rebacz NA, Lee IY, Katzenellenbogen BS, Katzenellenbogen JA | title = Pyrazolo[1,5-a]pyrimidines: estrogen receptor ligands possessing estrogen receptor beta antagonist activity | journal = Journal of Medicinal Chemistry | volume = 47 | issue = 24 | pages = 5872–93 | date = November 2004 | pmid = 15537344 | doi = 10.1021/jm049631k | url = https://figshare.com/articles/Pyrazolo_1_5_i_a_i_pyrimidines_Estrogen_Receptor_Ligands_Possessing_Estrogen_Receptor_Antagonist_Activity/3315259 | url-access = subscription }}