PSB-10

{{Use American English|date=January 2019}} {{Use mdy dates|date=January 2019}}{{Short description|Chemical compound

}}

{{Drugbox

| Verifiedfields = changed

| Watchedfields = changed

| verifiedrevid = 444488867

| IUPAC_name = (8R)-ethyl-4-methyl-2-(2,3,5-trichlorophenyl)-4,5,7,8-tetrahydro-1H-imidazo[2,1-i]purin-5-one

| image = PSB-10.svg

| width = 240

| tradename =

| pregnancy_AU =

| pregnancy_US =

| pregnancy_category =

| legal_AU =

| legal_CA =

| legal_UK =

| legal_US =

| legal_status =

| bioavailability =

| protein_bound =

| metabolism =

| excretion =

| index2_label = HCl

| CAS_number_Ref = {{cascite|correct|CAS}}

| CAS_number = 439902-54-2

| CAS_number2_Ref = {{cascite|correct|CAS}}

| CAS_number2 = 591771-91-4

| IUPHAR_ligand = 5619

| ATC_prefix =

| ATC_suffix =

| PubChem = 10318703

| DrugBank_Ref = {{drugbankcite|correct|drugbank}}

| DrugBank =

| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}}

| ChemSpiderID = 8494167

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = 2DRZ23E4F7

| UNII2_Ref = {{fdacite|correct|FDA}}

| UNII2 = C2R36CZP9N

| ChEMBL_Ref = {{ebicite|changed|EBI}}

| ChEMBL = 1562432

| C=16 | H=14 | Cl=3 | N=5 | O=1

| smiles = Clc2cc(Cl)cc(c2Cl)C(=N3)NC1C3N(C)C(=O)N4C1=NC(C4)CC

| StdInChI_Ref = {{stdinchicite|changed|chemspider}}

| StdInChI = 1S/C16H14Cl3N5O/c1-3-8-6-24-15(20-8)12-14(23(2)16(24)25)22-13(21-12)9-4-7(17)5-10(18)11(9)19/h4-5,8H,3,6H2,1-2H3,(H,21,22)/t8-/m1/s1

| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}}

| StdInChIKey = YYDHUJWLNPIBDS-MRVPVSSYSA-N

| synonyms = PSB-10

| melting_point =

| melting_high =

}}

PSB-10 is a drug which acts as a selective antagonist{{cite journal | vauthors = Ozola V, Thorand M, Diekmann M, Qurishi R, Schumacher B, Jacobson KA, Müller CE | title = 2-Phenylimidazo[2,1-i]purin-5-ones: structure-activity relationships and characterization of potent and selective inverse agonists at Human A3 adenosine receptors | journal = Bioorg Med Chem | volume = 11 | issue = 3 | pages = 347–56 | year = 2003 | pmid = 12517430 | doi = 10.1016/S0968-0896(02)00456-X | pmc = 8376400 }} for the adenosine A3 receptor (ki value at human A3 receptor is 0.44 nM), with high selectivity over the other three adenosine receptor subtypes (ki values at human A1, A2A and A2B receptors are 4.1, 3.3 and 30 μM). Further pharmacological experiments in a [35S]GTPγS binding assay using hA3-CHO-cells indicated that PSB-10 acts as an inverse agonist (IC50 = 4 nM). It has been shown to produce antiinflammatory effects in animal studies.{{cite journal | vauthors = Bilkei-Gorzo A, Abo-Salem OM, Hayallah AM, Michel K, Müller CE, Zimmer A | title = Adenosine receptor subtype-selective antagonists in inflammation and hyperalgesia | journal = Naunyn-Schmiedeberg's Archives of Pharmacology | volume = 377 | issue = 1 | pages = 65–76 |date=March 2008 | pmid = 18188542 | doi = 10.1007/s00210-007-0252-9 | s2cid = 6110998 }} Simple xanthine derivatives such as caffeine and DPCPX have generally low affinity for the A3 subtype and must be extended by expanding the ring system and adding an aromatic group to give high A3 affinity and selectivity.{{cite journal | author = Müller CE | title = Medicinal chemistry of adenosine A3 receptor ligands | journal = Current Topics in Medicinal Chemistry | volume = 3 | issue = 4 | pages = 445–62 | year = 2003 | pmid = 12570761 | doi = 10.2174/1568026033392174 | url = http://www.bentham-direct.org/pages/content.php?CTMC/2003/00000003/00000004/0008R.SGM | access-date = April 28, 2020 | archive-url = https://archive.today/20130414092030/http://www.bentham-direct.org/pages/content.php?CTMC/2003/00000003/00000004/0008R.SGM | archive-date = April 14, 2013 | url-status = usurped | url-access = subscription }} The affinity towards adenosine A3 subtype was measured against the radioligand PSB-11.{{cite journal | vauthors = Müller CE, Diekmann M, Thorand M, Ozola V | title = [(3)H]8-Ethyl-4-methyl-2-phenyl-(8R)-4,5,7,8-tetrahydro-1H-imidazo[2,1-i]-purin-5-one ([(3)H]PSB-11), a novel high-affinity antagonist radioligand for human A(3) adenosine receptors. | journal = Bioorg Med Chem Lett | volume = 12 | issue = 3 | pages = 501–3 | year = 2002 | pmid = 11814828 | doi = 10.1016/S0960-894X(01)00785-5 }}

References