PSB-KD107

{{cs1 config|name-list-format=vanc|display-authors=6}}

{{Drugbox

| IUPAC_name = 9-[2-(1H-indol-3-yl)ethyl]-1,3-dimethyl-7,8-dihydro-6H-purino[7,8-a]pyrimidine-2,4-dione

| image = PSB-KD107_structure.png

| width =

| tradename =

| routes_of_administration =

| CAS_number = 955121-65-0

| UNII =

| ATC_prefix =

| PubChem = 44437220

| IUPHAR_ligand = 11081

| ChemSpiderID = 23301412

| ChEMBL = 239232

| C=20 | H=22 | N=6 | O=2

| smiles = CN1C2=C(C(=O)N(C1=O)C)N3CCCN(C3=N2)CCC4=CNC5=CC=CC=C54

| StdInChI = 1S/C20H22N6O2/c1-23-17-16(18(27)24(2)20(23)28)26-10-5-9-25(19(26)22-17)11-8-13-12-21-15-7-4-3-6-14(13)15/h3-4,6-7,12,21H,5,8-11H2,1-2H3

| StdInChIKey = PUJKERUFRDZALE-UHFFFAOYSA-N

}}

PSB-KD107 is an experimental drug that acts as a potent and selective agonist for the cannabinoid-like NAGly receptor, also known as GPR18. It has antiinflammatory effects, and has been studied in an animal model of Duchenne muscular dystrophy.{{cite journal | vauthors = Schoeder CT, Mahardhika AB, Drabczyńska A, Kieć-Kononowicz K, Müller CE | title = Discovery of Tricyclic Xanthines as Agonists of the Cannabinoid-Activated Orphan G-Protein-Coupled Receptor GPR18 | journal = ACS Medicinal Chemistry Letters | volume = 11 | issue = 10 | pages = 2024–2031 | date = October 2020 | pmid = 33062188 | doi = 10.1021/acsmedchemlett.0c00208 | pmc = 7549263 }}{{cite journal | vauthors = Dort J, Orfi Z, Fiscaletti M, Campeau PM, Dumont NA | title = Gpr18 agonist dampens inflammation, enhances myogenesis, and restores muscle function in models of Duchenne muscular dystrophy | journal = Frontiers in Cell and Developmental Biology | date = 2023 | volume = 11 | pages = 1187253 | pmid = 37645248 | doi = 10.3389/fcell.2023.1187253 | doi-access = free | pmc = 10461444 }}

References