PSB-KK1415
{{cs1 config|name-list-style=vanc|display-authors=6}}
{{Drugbox
| IUPAC_name = 7-[(4-chlorophenyl)methyl]-8-[2-(1H-indol-3-yl)ethylamino]-1,3-dimethylpurine-2,6-dione
| image = PSB-KK1415_structure.png
| width =
| tradename =
| routes_of_administration =
| CAS_number = 885896-26-4
| UNII =
| ATC_prefix =
| PubChem = 4874764
| IUPHAR_ligand =
| ChemSpiderID = 4059043
| C=24 | H=23 | Cl=1 | N=6 | O=2
| smiles = CN1C2=C(C(=O)N(C1=O)C)N(C(=N2)NCCC3=CNC4=CC=CC=C43)CC5=CC=C(C=C5)Cl
| StdInChI = 1S/C24H23ClN6O2/c1-29-21-20(22(32)30(2)24(29)33)31(14-15-7-9-17(25)10-8-15)23(28-21)26-12-11-16-13-27-19-6-4-3-5-18(16)19/h3-10,13,27H,11-12,14H2,1-2H3,(H,26,28)
| StdInChIKey = FHFDQEPXKZVEOI-UHFFFAOYSA-N
}}
PSB-KK1415 is an experimental drug that acts as a potent and selective agonist for the cannabinoid-like NAGly receptor, also known as GPR18. It has potential applications in studying the immune system and development of cancer.{{cite journal | vauthors = Mahardhika AB, Załuski M, Schoeder CT, Boshta NM, Schabikowski J, Perri F, Łażewska D, Neumann A, Kremers S, Oneto A, Ressemann A, Latacz G, Namasivayam V, Kieć-Kononowicz K, Müller CE | title = Potent, Selective Agonists for the Cannabinoid-like Orphan G Protein-Coupled Receptor GPR18: A Promising Drug Target for Cancer and Immunity | journal = Journal of Medicinal Chemistry | volume = 67 | issue = 12 | pages = 9896–9926 | date = June 2024 | pmid = 38885438 | doi = 10.1021/acs.jmedchem.3c02423 }}