PSB-SB-1202
{{Short description|Chemical compound}}
{{Drugbox
| IUPAC_name = 7-pentyl-5-methoxy-3-(2-methoxybenzyl)-2H-chromen-2-one
| image = PSB-SB-1202_structure.png
| width = 280
| tradename =
| CAS_number = 1399049-60-5
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = 429P6KRK5A
| PubChem = 70677953
| ChemSpiderID = 28668367
| C=23 | H=26 | O=4
| smiles = O=C1C(CC2=C(OC)C=CC=C2)=CC3=C(C=C(CCCCC)C=C3OC)O1
| StdInChI = 1S/C23H26O4/c1-4-5-6-9-16-12-21(26-3)19-15-18(23(24)27-22(19)13-16)14-17-10-7-8-11-20(17)25-2/h7-8,10-13,15H,4-6,9,14H2,1-3H3
| StdInChIKey = VZYCAUIYIZSPQY-UHFFFAOYSA-N
}}
PSB-SB-1202 is a coumarin derivative which is an agonist at the cannabinoid receptors CB1 and CB2, with a CB1 Ki of 32nM and a CB2 Ki of 49nM.{{cite journal | vauthors = Rempel V, Volz N, Hinz S, Karcz T, Meliciani I, Nieger M, Wenzel W, Bräse S, Müller CE | display-authors = 6 | title = 7-Alkyl-3-benzylcoumarins: a versatile scaffold for the development of potent and selective cannabinoid receptor agonists and antagonists | journal = Journal of Medicinal Chemistry | volume = 55 | issue = 18 | pages = 7967–77 | date = September 2012 | pmid = 22916707 | doi = 10.1021/jm3008213 }} It is also a weak antagonist at the related receptor GPR55, with an IC50 of 6350nM, but has no significant affinity for GPR18.{{cite journal | vauthors = Rempel V, Volz N, Gläser F, Nieger M, Bräse S, Müller CE | title = Antagonists for the orphan G-protein-coupled receptor GPR55 based on a coumarin scaffold | journal = Journal of Medicinal Chemistry | volume = 56 | issue = 11 | pages = 4798–810 | date = June 2013 | pmid = 23679955 | doi = 10.1021/jm4005175 }}