PX-1

{{Short description|Chemical compound}}

{{Drugbox

| IUPAC_name = (S)-N-(1-amino-1-oxo-3-phenylpropan-2-yl)-1-(5-fluoropentyl)-1H-indole-3-carboxamide

| image = PX-1.svg

| image_class = skin-invert-image

| tradename =

| pregnancy_AU =

| pregnancy_US =

| pregnancy_category =

| legal_AU =

| legal_CA = Schedule II

| legal_DE = NpSG

| legal_UK = Class B

| legal_US =

| legal_status =

| routes_of_administration =

| bioavailability =

| protein_bound =

| metabolism =

| elimination_half-life =

| excretion =

| CAS_number_Ref = {{cascite|correct|CAS}}

| CAS_number = 2221100-71-4

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = BJ7SBQ2H5I

| ATC_prefix =

| ATC_suffix =

| PubChem = 125181260

| ChemSpiderID = 32055575

| smiles = O=C(N[C@H](C(N)=O)CC1=CC=CC=C1)C2=CN(CCCCCF)C3=C2C=CC=C3

| StdInChI = 1S/C23H26FN3O2/c24-13-7-2-8-14-27-16-19(18-11-5-6-12-21(18)27)23(29)26-20(22(25)28)15-17-9-3-1-4-10-17/h1,3-6,9-12,16,20H,2,7-8,13-15H2,(H2,25,28)(H,26,29)/t20-/m0/s1

| StdInChIKey = DDVANTXQCRMRFF-FQEVSTJZSA-N

| C=23 | H=26 | N=3 | O=2 | F=1

| molecular_weight =

}}

PX-1 (also known as 5F-APP-PICA and SRF-30) is an indole-based synthetic cannabinoid that has been sold online as a designer drug.{{cite web | url=https://www.caymanchem.com/product/16201 | title=PX 1 | publisher=Cayman Chemical | access-date=15 July 2015}}{{cite journal | vauthors = Presley BC, Logan BK, Jansen-Varnum SA | title = Phase I metabolism of synthetic cannabinoid receptor agonist PX-1 (5F-APP-PICA) via incubation with human liver microsomes and UHPLC-HRMS | journal = Biomedical Chromatography | volume = 34 | issue = 3 | pages = e4786 | date = March 2020 | pmid = 31863591 | doi = 10.1002/bmc.4786 | s2cid = 209435138 }}{{cite journal | vauthors = Dahm P, Thomas A, Rothschild MA, Thevis M, Mercer-Chalmers-Bender K | title = Phase I-metabolism studies of the synthetic cannabinoids PX-1 and PX-2 using three different in vitro models | journal = Forensic Toxicology | volume = 40 | issue = 2 | pages = 244–262 | date = July 2022 | pmid = 36454402 | pmc = 9715525 | doi = 10.1007/s11419-021-00606-6 | s2cid = 245540105 }}