Palladium(II) nitrate

{{chembox

| Verifiedfields = changed

| verifiedrevid = 433052015

| Name = Palladium(II) nitrate

| ImageFile1 = Palladium nitrate.png

| ImageFile2 = Pd(NO3)2(ICD425998).png

| ImageName = Palladium(II) nitrate

| IUPACName = Palladium(II) nitrate

| OtherNames = Palladium nitrate
Palladous nitrate

|Section1={{Chembox Identifiers

| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}

| ChemSpiderID = 23306

| PubChem = 24932

| InChI = 1/2NO3.Pd/c2*2-1(3)4;/q2*-1;+2

| InChIKey = GPNDARIEYHPYAY-UHFFFAOYAP

| SMILES = [Pd+2].[O-][N+]([O-])=O.[O-][N+]([O-])=O

| StdInChI_Ref = {{stdinchicite|correct|chemspider}}

| StdInChI = 1S/2NO3.Pd/c2*2-1(3)4;/q2*-1;+2

| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}

| StdInChIKey = GPNDARIEYHPYAY-UHFFFAOYSA-N

| CASNo = 10102-05-3

| CASNo_Ref = {{cascite|correct|CAS}}

| UNII_Ref = {{fdacite|changed|FDA}}

| UNII = 5G27LBZ05U

| RTECS =

}}/

|Section2={{Chembox Properties

| Formula = Pd(NO₃)₂

| MolarMass = 230.43 g/mol

| Appearance = yellow solid

| Density = 3.546 g/cm³

| Solubility = Soluble

| MeltingPt = Decomposes >100 °C

}}

|Section3={{Chembox Structure

| Coordination =

| CrystalStruct =

}}

|Section7={{Chembox Hazards

| ExternalSDS =

| MainHazards = Irritant, possibility of allergic reaction

| FlashPt = Non-flammable

| HPhrases = {{HPhrases|}}

| PPhrases = {{PPhrases|}}

| GHS_ref =

}}

|Section8={{Chembox Related

| OtherAnions = Palladium(II) chloride

| OtherCations = Nickel(II) nitrate

| OtherCompounds = Silver nitrate

}}

}}

Palladium(II) nitrate is the inorganic compound with the formula Pd(NO₃)₂.(H₂O)_x where x = 0 or 2. The anhydrous and dihydrate are deliquescent solids. According to X-ray crystallography, both compounds feature square planar Pd(II) with unidentate nitrate ligands. The anhydrous compound, which is a coordination polymer, is yellow.{{cite journal |doi=10.1002/chem.201405355|title=Oxoanionic Noble Metal Compounds from Fuming Nitric Acid: The Palladium Examples Pd(NO₃)₂ and Pd(CH₃SO₃)₂|year=2015|last1=Bruns|first1=Jörn|last2=Klüner|first2=Thorsten|last3=Wickleder|first3=Mathias S.|journal=Chemistry - A European Journal|volume=21|issue=3|pages=1294–1301|pmid=25431333}}{{cite journal |doi=10.1016/0025-5408(91)90021-D|title=Crystal Structure of Pd(NO₃)₂(H₂O)₂|year=1991|last1=Laligant|first1=Y.|last2=Ferey|first2=G.|last3=Le Bail|first3=A.|journal=Materials Research Bulletin|volume=26|issue=4|pages=269–275}}

As a solution in nitric acid, Pd(NO₃)₂ catalyzes the conversion of alkenes to dinitrate esters. Its pyrolysis affords palladium oxide.Timothy T. Wenzel "Palladium(II) Nitrate" Encyclopedia of Reagents for Organic Synthesis 2001, John Wiley & Sons. {{doi| 10.1002/047084289X.rp013}}