Palladium(II) perchlorate

{{Chembox

| Reference =

| Name =

| IUPACName =

| PIN =

| SystematicName = Palladium(II) diperchlorate

| OtherNames = {{Unbulleted list

| Palladium diperchlorate

}}

| data page pagename =

| ImageFile = Pd(ClO4)2.svg

| ImageSize =

| ImageAlt =

| ImageName =

| ImageCaption =

| ImageFile1 =

| ImageSize1 =

| ImageAlt1 =

| ImageName1 =

| ImageCaption1 =

| ImageFileL1 =

| ImageSizeL1 =

| ImageAltL1 =

| ImageNameL1 =

| ImageFileR1 =

| ImageSizeR1 =

| ImageAltR1 =

| ImageNameR1 =

| Section1 = {{Chembox Identifiers

| 3DMet =

| Abbreviations =

| Beilstein =

| CASNo =

| CASNo_Comment =

| CASNoOther =

| ChEBI =

| ChemSpiderID =

| EINECS =

| EC_number =

| EC_number_Comment=

| Gmelin =

| InChI = 1S/2ClHO4.Pd/c2*2-1(3,4)5;/h2*(H,2,3,4,5);/q;;+2/p-2

| KEGG =

| MeSHName =

| PubChem = 20221938

| RTECS =

| SMILES = [O-]Cl(=O)(=O)=O.[O-]Cl(=O)(=O)=O.[Pd+2]

| UNNumber =

}}

| Section2 = {{Chembox Properties

| AtmosphericOHRateConstant =

| Appearance = Light-brown solid

| BoilingPt =

| BoilingPtC =

| BoilingPt_ref =

| BoilingPt_notes=

| Density =

| Formula = Pd(ClO₄)₂

| HenryConstant =

| LogP =

| MolarMass = 305.32 g/mol

| MeltingPt =

| MeltingPtC =

| MeltingPt_ref =

| MeltingPt_notes=

| pKa =

| pKb =

| Solubility = Soluble

| SolubleOther =

| Solvent =

| VaporPressure =

}}

| Section3 = {{Chembox Structure

| Coordination =

| CrystalStruct =

| MolShape =

}}

| Section4 = {{Chembox Thermochemistry

| DeltaGf =

| DeltaHc =

| DeltaHf =

| Entropy =

| HeatCapacity =

}}

| Section5 = {{Chembox Explosive

| ShockSens =

| FrictionSens =

| DetonationV =

| REFactor =

}}

| Section7 = {{Chembox Hazards

| AutoignitionPt =

| ExploLimits =

| FlashPt =

| LD50 =

| LC50 =

| MainHazards =

| NFPA-H =

| NFPA-F =

| NFPA-I =

| NFPA-S =

| PEL =

| REL =

| ExternalSDS =

| GHSPictograms =

| GHSSignalWord =

| HPhrases =

| PPhrases =

}}

| Section9 = {{Chembox Related

| OtherAnions =

| OtherCations =

| OtherFunction =

| OtherFunction_label =

| OtherCompounds =

}}

}}

Palladium(II) perchlorate is an inorganic chemical compound with the formula Pd(ClO₄)₂. It is a light-brown solid produced by the reaction of dichlorine hexoxide and palladium(II) chloride followed by heating at 60 °C in a vacuum:

:3 PdCl₂ + 4 Cl₂O₆ → 3 Pd(ClO₄)₂ + 4 Cl₂

Aqueous solutions of palladium(II) perchlorate can be produced by the addition of perchloric acid to a solution of palladium(II) nitrate.{{cite journal |author1=A. K. Sundaram |author2=E. B. Sandell |title=Chloro Complexes of Palladium(II) in Solution |journal=Journal of the American Chemical Society |date=1955 |volume=77 |issue=4 |pages=855–857 |doi=10.1021/ja01609a008 |language=en}}