Pallidol

{{chembox

| Verifiedfields = changed

| Watchedfields = changed

| verifiedrevid = 440126745

| Name = Pallidol

| ImageFile = Pallidol.svg

| ImageSize = 200px

| ImageName = Chemical structure of pallidol

| ImageAlt = Chemical structure of pallidol

| PIN = (4bR,5R,9bR,10R)-5,10-Bis(4-hydroxyphenyl)-4b,5,9b,10-tetrahydroindeno[2,1-a]indene-1,3,6,8-tetrol

| OtherNames =

|Section1={{Chembox Identifiers

| CASNo = 105037-88-5

| CASNo_Ref = {{cascite|correct|??}}

| CASNoOther =

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = QE5TL72TJ8

| PubChem = 484757

| ChEBI_Ref = {{ebicite|changed|EBI}}

| ChEBI = 76173

| SMILES = C1=CC(=CC=C1C2C3C(C(C4=C(C=C(C=C34)O)O)C5=CC=C(C=C5)O)C6=CC(=CC(=C26)O)O)O

| StdInChI = 1S/C28H22O6/c29-15-5-1-13(2-6-15)23-25-19(9-17(31)11-21(25)33)28-24(14-3-7-16(30)8-4-14)26-20(27(23)28)10-18(32)12-22(26)34/h1-12,23-24,27-34H/t23-,24-,27+,28+/m1/s1

| StdInChIKey = YNVJOQCPHWKWSO-ZBVBGGFBSA-N

| MeSHName =

}}

|Section2={{Chembox Properties

| Formula = C₂₈H₂₂O₆

| MolarMass = 454.47 g/mol

| Appearance =

| Density =

| MeltingPt =

| BoilingPt =

| Solubility =

}}

|Section3={{Chembox Hazards

| MainHazards =

| FlashPt =

| AutoignitionPt =

| GHS_ref =}}

}}

Pallidol is a resveratrol dimer. It can be found in red wine,Pallidol, a resveratrol dimer from red wine, is a selective singlet oxygen quencher. Shan He, Liyan Jiang, Bin Wu, Yuanjiang Pan and Cuirong Sun, Biochemical and Biophysical Research Communications, Volume 379, Issue 2, 6 February 2009, Pages 283-287, {{doi|10.1016/j.bbrc.2008.12.039}} in Cissus pallidaPallidol, a resveratrol dimer from Cissus pallida. Mushtaq A. Khan, Shah G. Nabi, Satya Prakash and Asif Zaman, Phytochemistry, Volume 25, Issue 8, 17 July 1986, Pages 1945-1948, {{doi|10.1016/S0031-9422(00)81180-2}} or in Parthenocissus laetevirens.Characterization of polyphenol compounds from the roots and stems of Parthenocissus laetevirens by high-performance liquid chromatography/tandem mass spectrometry. Juanjuan Chen, Shan He, Hui Mao, Cuirong Sun and Yuanjiang Pan, Rapid Commun. Mass Spectrom. 2009, 23, pp. 737–744, {{doi|10.1002/rcm}}