Panuramine

{{short description|Chemical compound}}

{{Drugbox

| IUPAC_name = N-{[1-(naphthalen-2-ylmethyl)piperidin-4-yl]carbamoyl}benzamide

| image = Panuramine.svg

| image_class = skin-invert-image

| width = 225

| tradename =

| pregnancy_category =

| legal_status =

| routes_of_administration =

| bioavailability =

| metabolism =

| elimination_half-life =

| excretion =

| CAS_number = 80349-58-2

| CAS_supplemental =
{{CAS|80349-03-7}} (HCl)

| ATC_prefix = None

| ATC_suffix =

| PubChem = 72002

| ChemSpiderID = 65002

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = 1UWS3T8EAB

| C=24 | H=25 | N=3 | O=2

| smiles = O=C(c1ccccc1)NC(=O)NC4CCN(Cc2ccc3c(c2)cccc3)CC4

}}

Panuramine (Wy-26,002) is an antidepressant which was synthesized in 1981 by Wyeth.{{cite book | author = David J. Triggle | title = Dictionary of pharmacological agents | publisher = Chapman & Hall | location = London | year = 1997 | isbn = 0-412-46630-9 | url = https://books.google.com/books?id=A0THacd46ZsC&q=panuramine&pg=PA1519}} It acts as a potent and selective serotonin reuptake inhibitor (SSRI).{{cite journal |vauthors=Blurton PA, Broadhurst AM, Cross JA, Ennis C, Wood MD, Wyllie MG | title = Panuramine, a selective inhibitor of uptake of 5-hydroxytryptamine in the brain of the rat | journal = Neuropharmacology | volume = 23 | issue = 9 | pages = 1049–52 |date=September 1984 | pmid = 6514142 | doi = 10.1016/0028-3908(84)90127-8| s2cid = 27269043 }} It was never marketed.

See also

References