Paradol
{{for|the French opera singer|Lucinde Paradol}}
{{chembox
| Verifiedfields = changed
| Watchedfields = changed
| verifiedrevid = 414648992
| ImageFile=Paradol.png
| ImageSize=200px
| PIN=1-(4-Hydroxy-3-methoxyphenyl)decan-3-one
| OtherNames=[6]-Paradol
|Section1={{Chembox Identifiers
| CASNo_Ref = {{cascite|correct|??}}
| CASNo=27113-22-0
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = BO24ID7E9U
| PubChem=94378
| SMILES=CCCCCCCC(=O)CCC1=CC(=C(C=C1)O)OC
| EINECS = 248-228-1
| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}}
| ChemSpiderID = 85173
| InChI = 1/C17H26O3/c1-3-4-5-6-7-8-15(18)11-9-14-10-12-16(19)17(13-14)20-2/h10,12-13,19H,3-9,11H2,1-2H3
| InChIKey = CZNLTCTYLMYLHL-UHFFFAOYAE
| StdInChI_Ref = {{stdinchicite|changed|chemspider}}
| StdInChI = 1S/C17H26O3/c1-3-4-5-6-7-8-15(18)11-9-14-10-12-16(19)17(13-14)20-2/h10,12-13,19H,3-9,11H2,1-2H3
| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}}
| StdInChIKey = CZNLTCTYLMYLHL-UHFFFAOYSA-N
| RTECS =
| MeSHName = C421614
| ChEBI =
| KEGG_Ref = {{keggcite|changed|kegg}}
| KEGG = C10482
}}
|Section2={{Chembox Properties
| Formula = C17H26O3
| MolarMass = 278.39 g/mol
| Appearance=
| Density=
| MeltingPt=
| BoilingPt=
| Solubility=
}}
|Section3={{Chembox Hazards
| MainHazards=
| FlashPt=
| AutoignitionPt =
}}
}}
Paradol is the active flavor constituent of the seeds of Guinea pepper (Aframomum melegueta or grains of paradise).{{Cite journal | journal = Flavour and Fragrance Journal | volume = 21 | issue = 1 | pages = 162–165 | date = 2006 | title = Chemical composition of absolute and supercritical carbon dioxide extract of Aframomum melegueta | author = Xavier Fernandez | author2 = Christine Pintaric | author3 = Louisette Lizzani-Cuvelier | author4 = André-Michel Loiseau | author5 = Alain Morello | author6 = Patrick Pellerin | name-list-style = amp | doi = 10.1002/ffj.1554}} It is also found in ginger.{{cite journal |vauthors=Jolad SD, Lantz RC, Chen GJ, Bates RB, Timmermann BN | title = Commercially processed dry ginger (Zingiber officinale): composition and effects on LPS-stimulated PGE2 production | journal = Phytochemistry | date = 2005 | volume = 66 | issue = 13 | pages = 1614–1635 | pmid= 15996695 | doi=10.1016/j.phytochem.2005.05.007| bibcode = 2005PChem..66.1614J }} Paradol has been found to have antioxidant and antitumor promoting effects in a mouse model.{{cite journal |vauthors=Chung WY, Jung YJ, Surh YJ, Lee SS, Park KK |title=Antioxidative and antitumor promoting effects of [6]-paradol and its homologs |journal=Mutat. Res. |volume=496 |issue=1–2 |pages=199–206 |year=2001 |pmid=11551496 |doi=10.1016/s1383-5718(01)00221-2|bibcode=2001MRGTE.496..199C }}
It is used in flavors as an essential oil to give spiciness.