Parathion S

{{Chembox

| Name = Parathion S

| ImageFile = Parathion S.svg

| ImageSize = 200px

| PIN = O,O-Diethyl S-(4-nitrophenyl) phosphorothioate

| OtherNames = S-Phenyl parathion

| Section1 = {{Chembox Identifiers

| CASNo = 3270-86-8

| ChemSpiderID = 2297420

| PubChem = 3032440

| SMILES = CCOP(=O)(OCC)Sc1ccc(cc1)[N+](=O)[O-]

| StdInChI = InChI=1S/C10H14NO5PS/c1-3-15-17(14,16-4-2)18-10-7-5-9(6-8-10)11(12)13/h5-8H,3-4H2,1-2H3

| StdInChIKey = DSVCXDBXXBVSEB-UHFFFAOYSA-N

}}

| Section2 = {{Chembox Properties

| C=10|H=14|N=1|O=5|P=1|S=1

| Appearance = Pale yellow crystalline solid

}}

| Section3 = {{Chembox Hazards

| LD50 = 107 μg/kg (mice, intraperitoneal){{cite web |title=ChemIDplus |url=https://chem.nlm.nih.gov/chemidplus/rn/3270-86-8}}
4.41 mg/kg (rats, oral)

}}

}}

Parathion S is an organophosphate related to the organophosphate insecticide paraoxon and parathion. It's the structural isomer of parathion. Parathion S is a potent acetylcholinesterase inhibitor.{{cite journal |last1=DIGGLE |first1=WM |last2=GAGE |first2=JC |title=Cholinesterase inhibition in vitro by OO-diethyl O-p-nitrophenyl thiophosphate (parathion, E 605). |journal=The Biochemical Journal |date=September 1951 |volume=49 |issue=4 |pages=491–4 |pmid=14886312 |pmc=1197537|doi=10.1042/bj0490491 }}{{cite journal |last1=ALDRIDGE |first1=WN |last2=DAVISON |first2=AN |title=The inhibition of erythrocyte cholinesterase by tri-esters of phosphoric acid. II. Diethyl p-nitrophenyl thionphosphate (E605) and analogues. |journal=The Biochemical Journal |date=December 1952 |volume=52 |issue=4 |pages=663–71 |pmid=13018298 |pmc=1198077|doi=10.1042/bj0520663 }}