Parsaclisib

{{Short description|Investigational medication}}

{{Infobox drug

| image = Parsaclisib.svg

| alt =

| caption =

| pronounce =

| tradename =

| Drugs.com =

| MedlinePlus =

| pregnancy_AU =

| pregnancy_AU_comment =

| pregnancy_category=

| routes_of_administration =

| ATC_prefix = L01

| ATC_suffix = EM05

| legal_AU =

| legal_AU_comment =

| legal_BR =

| legal_BR_comment =

| legal_CA =

| legal_CA_comment =

| legal_DE =

| legal_DE_comment =

| legal_NZ =

| legal_NZ_comment =

| legal_UK =

| legal_UK_comment =

| legal_US =

| legal_US_comment =

| legal_EU =

| legal_EU_comment =

| legal_UN =

| legal_UN_comment =

| legal_status =

| bioavailability =

| protein_bound =

| metabolism =

| metabolites =

| onset =

| elimination_half-life =

| duration_of_action=

| excretion =

| CAS_number = 1426698-88-5

| PubChem = 86677874

| IUPHAR_ligand =

| DrugBank = DB14867

| ChemSpiderID = 64835232

| UNII = OS7097575K

| KEGG = D11437

| ChEBI =

| ChEMBL = 4297615

| NIAID_ChemDB =

| PDB_ligand =

| synonyms =

| IUPAC_name = 4R)-4-[3-[(1S)-1-(4-amino-3-methylpyrazolo[3,4-d]pyrimidin-1-yl)ethyl]-5-chloro-2-ethoxy-6-fluorophenyl]pyrrolidin-2-one

| C=20 | H=22 | Cl=1 | F=1 | N=6 | O=2

| StdInChI = InChI=1S/C20H22ClFN6O2/c1-4-30-18-12(6-13(21)17(22)16(18)11-5-14(29)24-7-11)10(3)28-20-15(9(2)27-28)19(23)25-8-26-20/h6,8,10-11H,4-5,7H2,1-3H3,(H,24,29)(H2,23,25,26)/t10-,11-/m0/s1

| StdInChIKey = ZQPDJCIXJHUERQ-QWRGUYRKSA-N

| SMILES = CCOC1=C(C(=C(C=C1[C@H](C)N2C3=NC=NC(=C3C(=N2)C)N)Cl)F)[C@H]4CC(=O)NC4

}}

Parsaclisib is an investigational drug that it being evaluated for the treatment of B-cell malignancies. It is a PI3Kδ (phosphoinositide 3-kinase) inhibitor.{{cite journal | vauthors = Gerds AT, Bartalucci N, Assad A, Yacoub A | title = Targeting the PI3K pathway in myeloproliferative neoplasms | journal = Expert Review of Anticancer Therapy | volume = 22 | issue = 8 | pages = 835–843 | date = August 2022 | pmid = 35763287 | doi = 10.1080/14737140.2022.2093192 | doi-access = free | hdl = 2158/1351132 | hdl-access = free }}{{cite web | title = Parsaclisib - Incyte Corporation | url = https://adisinsight.springer.com/drugs/800039479 | work = AdisInsight | publisher = Springer Nature Switzerland AG }}