Pavinetant
{{Short description|Chemical compound}}
{{Drugbox
| Verifiedfields =
| Watchedfields =
| verifiedrevid =
| IUPAC_name = 3-(methanesulfonamido)-2-phenyl-N-[(1S)-1-phenylpropyl]quinoline-4-carboxamide
| image = MLE-4901.svg
| width = 225px
| tradename =
| pregnancy_AU =
| pregnancy_US =
| pregnancy_category =
| legal_AU =
| legal_CA =
| legal_UK =
| legal_US =
| legal_status =
| routes_of_administration = By mouth
| bioavailability =
| protein_bound =
| metabolism =
| elimination_half-life =
| excretion =
| CAS_number_Ref =
| CAS_number = 941690-55-7
| CAS_supplemental =
| class =
| ATC_prefix =
| ATC_suffix =
| ATC_supplemental =
| PubChem = 23649245
| IUPHAR_ligand =
| DrugBank_Ref =
| DrugBank =
| ChemSpiderID_Ref =
| ChemSpiderID = 28189763
| UNII = 3U471ZVC5K
| KEGG = D11345
| ChEBI = 140478
| ChEMBL = 3545233
| synonyms = MLE-4901; AZD-4901; AZD-2624; AZ-12472520
| C=26 | H=25 | N=3 | O=3 | S=1
| SMILES = CC[C@@H](C1=CC=CC=C1)NC(=O)C2=C(C(=NC3=CC=CC=C32)C4=CC=CC=C4)NS(=O)(=O)C
| StdInChI_Ref =
| StdInChI = 1S/C26H25N3O3S/c1-3-21(18-12-6-4-7-13-18)28-26(30)23-20-16-10-11-17-22(20)27-24(19-14-8-5-9-15-19)25(23)29-33(2,31)32/h4-17,21,29H,3H2,1-2H3,(H,28,30)/t21-/m0/s1
| StdInChIKey_Ref =
| StdInChIKey = QYTBBBAHNIWFOD-NRFANRHFSA-N
}}
Pavinetant ({{abbrlink|INN|International Nonproprietary Name}}, {{abbrlink|USAN|United States Adopted Name}}; developmental code names MLE-4901, AZD-4901, AZ-12472520, AZD-2624), is a small-molecule, orally active, selective neurokinin-3 (NK3) receptor antagonist which was under development by AstraZeneca and Millendo Therapeutics for the treatment of hot flashes and polycystic ovary syndrome (PCOS).{{Cite web|url=http://adisinsight.springer.com/drugs/800038259|title = Pavinetant - Millendo Therapeutics - AdisInsight}}{{cite journal | vauthors = Malherbe P, Ballard TM, Ratni H | title = Tachykinin neurokinin 3 receptor antagonists: a patent review (2005 - 2010) | journal = Expert Opin Ther Pat | volume = 21 | issue = 5 | pages = 637–55 | year = 2011 | pmid = 21417773 | doi = 10.1517/13543776.2011.568482 | s2cid = 207473995 }}{{cite journal | vauthors = Sassarini J, Anderson RA | title = New pathways in the treatment for menopausal hot flushes | journal = Lancet | volume = 389| issue = 10081| pages = 1775–1777| year = 2017 | pmid = 28385351 | doi = 10.1016/S0140-6736(17)30886-3 | doi-access = free | hdl = 20.500.11820/f7c16947-678f-40f6-ac53-73343a9d44e7 | hdl-access = free }} It was also under investigation for the treatment of schizophrenia, but development was discontinued for this indication due to lack of effectiveness.{{cite journal | vauthors = Litman RE, Smith MA, Desai DG, Simpson T, Sweitzer D, Kanes SJ | title = The selective neurokinin 3 antagonist AZD2624 does not improve symptoms or cognition in schizophrenia: a proof-of-principle study | journal = J Clin Psychopharmacol | volume = 34 | issue = 2 | pages = 199–204 | year = 2014 | pmid = 24525659 | doi = 10.1097/JCP.0000000000000071 | s2cid = 33936765 }} In November 2017, development of the medication for hot flashes and PCOS was also terminated after its developer assessed the clinical risks and benefits.
See also
References
{{Reflist}}
External links
- [http://adisinsight.springer.com/drugs/800038259 Pavinetant - AdisInsight]
{{Neurokinin receptor modulators}}
Category:NK3 receptor antagonists
{{Genito-urinary-drug-stub}}
{{Nervous-system-drug-stub}}