Pelubiprofen
{{Short description|Chemical compound}}
{{cs1 config|name-list-style=vanc|display-authors=6}}
{{Infobox drug
| image = Pelubiprofen.svg
| image_class = skin-invert-image
| alt =
| caption =
| pronounce =
| tradename = Pelubi
| Drugs.com =
| MedlinePlus =
| pregnancy_AU =
| pregnancy_AU_comment =
| pregnancy_category=
| routes_of_administration =
| ATCvet =
| ATC_prefix = M01
| ATC_suffix = AE20
| legal_AU =
| legal_AU_comment =
| legal_BR =
| legal_BR_comment =
| legal_CA =
| legal_CA_comment =
| legal_DE =
| legal_DE_comment =
| legal_NZ =
| legal_NZ_comment =
| legal_UK =
| legal_UK_comment =
| legal_US =
| legal_US_comment =
| legal_EU =
| legal_EU_comment =
| legal_UN =
| legal_UN_comment =
| legal_status = Rx in several countries
| bioavailability =
| protein_bound =
| metabolism =
| metabolites =
| onset =
| elimination_half-life =
| duration_of_action=
| excretion =
| CAS_number = 69956-77-0
| PubChem = 5282203
| UNII = 1619C79FVJ
| DrugBank = DB12150
| StdInChI=1S/C16H18O3/c1-11(16(18)19)13-8-6-12(7-9-13)10-14-4-2-3-5-15(14)17/h6-11H,2-5H2,1H3,(H,18,19)/b14-10+
| StdInChIKey=AUZUGWXLBGZUPP-GXDHUFHOSA-N
| smiles = CC(C1=CC=C(C=C1)/C=C/2\CCCCC2=O)C(=O)O
| IUPAC_name = 2-[4-[(E)-(2-Oxocyclohexylidene)methyl]phenyl]propanoic acid
| C = 16 | H = 18 | O = 3
}}
Pelubiprofen is a nonsteroidal anti-inflammatory drug of the profen class used to treat back pain and osteoarthritis.{{cite web | url = https://adisinsight.springer.com/drugs/800000947 | work = AdisInsight | publisher = Springer Nature Switzerland AG | title = Pelubiprofen - Daewon Pharmaceutical }}
Pelubiprofen was developed in South Korea by Daewon Pharmaceuticals and it is marketed in Korea and Russia,{{cite news | vauthors = Chan-Hyuk K | url = https://www.koreabiomed.com/news/articleView.html?idxno=22165 | title = Daewon Pharm wins $3 million deal to export Pelubi to Indonesia | date = 26 September 2023 | publisher = Korea Biomedial Review }} among other countries.
Research
Pelubiprofen is being studied for use in combination with eperisone.{{cite web | url = https://www.pharmaceutical-technology.com/data-insights/pelubiprofen-sr-daewon-pharmaceutical-chronic-low-back-pain-clbp-likelihood-of-approval/?cf-view | title = (Eperisone + pelubiprofen) by Daewon Pharmaceutical for Low Back Pain: Likelihood of Approval | website = pharmaceutical-technology.com | date = 5 June 2023 }}{{Dead link|date=June 2025 |bot=InternetArchiveBot |fix-attempted=yes }}
Because pelubiprofen has low water solubility, development of salt formulations with better solubility are being studied.{{cite journal | vauthors = Park JY, Oh DH, Park SW, Chae BR, Kim CW, Han SH, Shin HJ, Yeom SB, Lee DY, Park MK, Park SE, Park JB, Lee KT | title = Development of Pelubiprofen Tromethamine with Improved Gastrointestinal Safety and Absorption | journal = Pharmaceutics | volume = 13 | issue = 5 | page = 745 | date = May 2021 | pmid = 34070062 | pmc = 8158122 | doi = 10.3390/pharmaceutics13050745 | doi-access = free }}
Synthesis
Pelubiprofen can be prepared by the reaction of 1-(1-piperidino)cyclohexene (1) with ethyl 2-(4-formylphenyl)propanoate (2).Serradell, MN; Castaer, J.; RS-2131. Drugs Fut 1984, 9, 4, 275.Terada, Atsusuke; Naruto, Shunji; Wachi, Kazuyuki; Tanaka, Shigeru; Iizuka, Yoshio; Misaka, Eiichi (1984). "Synthesis and antiinflammatory activity of [(cycloalkylmethyl)phenyl]acetic acids and related compounds". Journal of Medicinal Chemistry. 27 (2): 212–216. doi:10.1021/jm00368a019.Atsusuke Terada, Shigeru Tanaka, & Eiichi Misaka, US4254274 (1981 to Sankyo Co Ltd).Yuan Weiguan, et al. CN111153791 (2020 to HUNAN JIUDIAN HONGYANG PHARMACEUTICAL Co., Ltd).Yuan Weiguan, et al. WO2021129651 (to Hunan Jiudian Pharmaceutical Co Ltd).Ning Hulin, et al. CN110041191 (2019 to HUNAN JIUDIAN HONGYANG PHARMACEUTICAL Co., Ltd.).[https://www.chemdrug.com/article/8/3284/16419229.html ChemDrug]
