Pentacarbonylhydridorhenium

{{chembox

| Watchedfields = changed

| verifiedrevid = 464197805

| ImageFile = Pentacarbonylhydridorhenium.svg

| ImageSize =

| ImageFile1 = Pentacarbonylhydridorhenium-3D-balls.png

| IUPACName = pentacarbonylhydridorhenium

| OtherNames =

|Section1={{Chembox Identifiers

| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}}

| ChemSpiderID =

| InChI = 1/5CO.Re.H/c5*1-2;;/rC5HO5Re/c6-1-11(2-7,3-8,4-9)5-10/h11H

| InChIKey = CNPMTNYPOCHKNC-AUQHHBNCAA

| StdInChI_Ref = {{stdinchicite|correct|chemspider}}

| StdInChI = 1S/5CO.Re.H/c5*1-2;;

| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}

| StdInChIKey = CNPMTNYPOCHKNC-UHFFFAOYSA-N

| CASNo = 16457-30-0

| PubChem = 139031000

| SMILES = C(#O)[ReH](C#O)(C#O)(C#O)C#O

}}

|Section2={{Chembox Properties

| Formula = ReH(CO)₅

| MolarMass = 327.265 g/mol

| Appearance = Colorless liquid

| Density = 2.30 g/mL, liquid

| MeltingPtC = 12.5

| BoilingPtC = 100

| BoilingPt_notes = (decomposes)

| Solubility = Insoluble

}}

|Section3={{Chembox Hazards

| MainHazards = Flammable

| FlashPt =

| AutoignitionPt =

}}

}}

Pentacarbonylhydridorhenium is a chemical compound with the formula ReH(CO)₅. This colorless liquid is a weak acid and represents one of the most important derivatives of dirhenium decacarbonyl (Re₂(CO)₁₀). It is synthesized by treating a methanolic solution of bromopentacarbonylrhenium(I) (Re(CO)₅Br) with zinc and acetic acid (HOAc).{{cite journal | author = Michael A. Urbancic, John R. Shapley | title = Pentacarbonylhydridorhenium | journal = Inorganic Syntheses | volume = 28 | pages = 165–8 | year = 1990 | doi =10.1002/9780470132593.ch43 | isbn = 9780470132593 }}

: Re(CO)₅Br + Zn + HOAc → ReH(CO)₅ + ZnBrOAc

It is moderately sensitive to light: samples turn yellow due to the formation of the metal cluster Re₃H(CO)₁₄

: 3 Re(CO)₅H → Re₃H(CO)₁₄ + H₂ + CO

At 100 °C, it decomposes to Re₂(CO)₁₀:

: 2 Re(CO)₅H → H₂ + Re₂(CO)₁₀