Pentanitroaniline

{{chembox

| Verifiedfields = changed

| Watchedfields = changed

| verifiedrevid = 424691132

| ImageFile = Pentanitroaniline.svg

| ImageSize = 150px

| ImageAlt = Skeletal formula

| ImageFile1 = Pentanitroaniline-3D-balls.png

| ImageSize1 = 160

| ImageAlt1 = Ball-and-stick model

| PIN=2,3,4,5,6-Pentanitroaniline

| OtherNames=2,3,4,5,6-Pentanitrobenzenamine

|Section1={{Chembox Identifiers

| CASNo_Ref = {{cascite|correct|CAS}}

| CASNo=21985-87-5

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = BW38Y827XU

| PubChem=11023554

| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}}

| ChemSpiderID = 9198736

| InChI = 1/C6H2N6O10/c7-1-2(8(13)14)4(10(17)18)6(12(21)22)5(11(19)20)3(1)9(15)16/h7H2

| InChIKey = XJYDCCKHUXCATF-UHFFFAOYAC

| StdInChI_Ref = {{stdinchicite|changed|chemspider}}

| StdInChI = 1S/C6H2N6O10/c7-1-2(8(13)14)4(10(17)18)6(12(21)22)5(11(19)20)3(1)9(15)16/h7H2

| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}}

| StdInChIKey = XJYDCCKHUXCATF-UHFFFAOYSA-N

| SMILES=C1(=C(C(=C(C(=C1[N+](=O)[O-])[N+](=O)[O-])[N+](=O)[O-])[N+](=O)[O-])[N+](=O)[O-])N

}}

|Section2={{Chembox Properties

| C=6 | H=2 | N=6 | O=10

| Appearance=

| Density=

| MeltingPt=

| BoilingPt=

| Solubility=

}}

|Section3={{Chembox Hazards

| MainHazards=

| FlashPt=

| AutoignitionPt =

}}

}}

Pentanitroaniline, sometimes called hexyl, is an explosive organic compound.{{Cite journal |last1=Klapötke |first1=Thomas M. |last2=Krumm |first2=Burkhard |last3=Riedelsheimer |first3=Christian |date=May 2022 |title=Spectroscopic, Structural and Energetic Properties of Pentanitroaniline |journal=Propellants, Explosives, Pyrotechnics |language=en |volume=47 |issue=5 |doi=10.1002/prep.202100372 |issn=0721-3115|doi-access=free }} It is a relatively sensitive explosive (much more so than TNT) that can be used as a base charge for detonators, although it is uncommon in this application.

Pentanitroaniline can be reacted with ammonia in benzene, dichloromethane or another similar solvent to produce triaminotrinitrobenzene (TATB), an insensitive high explosive, used in nuclear bombs and other critical applications.

Pentanitroaniline is regulated by the United States Department of Transportation (DoT) as a "forbidden explosive" that is too dangerous to transport over public thoroughfares or by air.

References

{{Reflist}}

Category:Nitrobenzene derivatives

Category:Anilines

{{Explosive-stub}}

{{Amine-stub}}