Pentolame

{{Short description|Chemical compound}}

{{Drugbox

| Verifiedfields =

| Watchedfields =

| verifiedrevid =

| IUPAC_name = (8R,9S,13S,14S,17S)-17-(5-Hydroxypentylamino)-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-3-ol

| image = Pentolame.svg

| width = 250

| tradename =

| pregnancy_AU =

| pregnancy_US =

| pregnancy_category =

| legal_AU =

| legal_CA =

| legal_UK =

| legal_US =

| legal_status =

| routes_of_administration =

| bioavailability =

| protein_bound =

| metabolism =

| elimination_half-life =

| excretion =

| CAS_number_Ref =

| CAS_number = 150748-24-6

| CAS_supplemental =

| ATC_prefix =

| ATC_suffix =

| ATC_supplemental =

| PubChem = 10473548

| IUPHAR_ligand =

| DrugBank_Ref =

| DrugBank =

| ChemSpiderID_Ref =

| ChemSpiderID = 8648959

| UNII =

| KEGG =

| ChEBI =

| ChEMBL =

| C=23 | H=35 | N=1 | O=2

| SMILES = C[C@]12CC[C@H]3[C@H]([C@@H]1CC[C@@H]2NCCCCCO)CCC4=C3C=CC(=C4)O

| StdInChI_Ref =

| StdInChI = 1S/C23H35NO2/c1-23-12-11-19-18-8-6-17(26)15-16(18)5-7-20(19)21(23)9-10-22(23)24-13-3-2-4-14-25/h6,8,15,19-22,24-26H,2-5,7,9-14H2,1H3/t19-,20-,21+,22+,23+/m1/s1

| StdInChIKey_Ref =

| StdInChIKey = CYIRNKIFROUCMA-VROINQGHSA-N

| synonyms = 17β-((5-Hydroxypentyl)amino)estradiol; 17β-[(5-Hydroxypentyl)amino]estra-1,3,5(10)-trien-3-ol

}}

Pentolame, also known as 17β-((5-hydroxypentyl)amino)estradiol is a synthetic, steroidal estrogen and a 17β-aminoestrogen with anticoagulant effects that was first described in 1993 and was never marketed.{{cite journal | vauthors = Lemini C, Rubio-Póo C, Silva G, García-Mondragón J, Zavala E, Mendoza-Patiño N, Castro D, Cruz-Almanza R, Mandoki JJ | title = Anticoagulant and estrogenic effects of two new 17 beta-aminoestrogens, butolame [17 beta-(4-hydroxy-1-butylamino)-1,3,5(10)-estratrien-3-ol] and pentolame [17 beta-(5-hydroxy-1-pentylamino)-1,3,5(10)-estratrien-3-ol] | journal = Steroids | volume = 58 | issue = 10 | pages = 457–61 | year = 1993 | pmid = 8256254 | doi = 10.1016/0039-128x(93)90002-5| s2cid = 54381037 }}{{cite journal | vauthors = Lemus AE, Jaimez R, Lemini C, Menjivar M, Silva G, Rubio-Poo C, Valenzuela F, Larrea F | title = Estrogenic effects of the synthetic aminoestrogen 17 beta-(5-hydroxy-1-pentylamino)-1,3,5(10)-estratrien-3-ol (pentolame) | journal = Steroids | volume = 63 | issue = 7–8 | pages = 433–8 | year = 1998 | pmid = 9654651 | doi = 10.1016/s0039-128x(98)00046-4| s2cid = 13582499 }}{{cite journal | vauthors = Jaimez R, Cooney A, Jackson K, Lemus AE, Lemini C, Cárdenas M, García R, Silva G, Larrea F | title = In vivo estrogen bioactivities and in vitro estrogen receptor binding and transcriptional activities of anticoagulant synthetic 17beta-aminoestrogens | journal = J. Steroid Biochem. Mol. Biol. | volume = 73 | issue = 1–2 | pages = 59–66 | year = 2000 | pmid = 10822025 | doi = 10.1016/s0960-0760(00)00053-4| s2cid = 40211307 }}