Perfluoropentacene

{{Chembox

| Verifiedfields = changed

| Watchedfields = changed

| verifiedrevid = 408116285

| ImageFile = Perfluoropentacene.svg

| ImageSize = 200px

| PIN = Tetradecafluoropentacene

| OtherNames =

|Section1={{Chembox Identifiers

| CASNo_Ref = {{cascite|correct|??}}

| CASNo = 646533-88-2

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = PXZ2S4ZY9P

| PubChem = 12143313

| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}}

| ChemSpiderID = 21431394

| SMILES = c12c(c(c3c(c1F)c(c4c(c3F)c(c(c(c4F)F)F)F)F)F)c(c5c(c2F)c(c(c(c5F)F)F)F)F

| InChI = InChI=1S/C22F14/c23-9-1-2(12(26)6-5(11(1)25)15(29)19(33)20(34)16(6)30)10(24)4-3(9)13(27)7-8(14(4)28)18(32)22(36)21(35)17(7)31

| StdInChIKey = AZVQGIPHTOBHAF-UHFFFAOYSA-N

}}

|Section2={{Chembox Properties

| C=22 | F=14

| Appearance = Dark blueish powder

| Density =

| MeltingPt =

| BoilingPt =

| Solubility =

}}

|Section3={{Chembox Hazards

| MainHazards =

| FlashPt =

| AutoignitionPt =

}}

}}

Perfluoropentacene (PFP) is an n-type organic semiconductor, which is made by fluorination of the p-type semiconductor pentacene.{{Cite journal | last1 = Salzmann | first1 = I. | last2 = Duhm | first2 = S. | last3 = Heimel | first3 = G. | last4 = Rabe | first4 = J. P. | last5 = Koch | first5 = N. | last6 = Oehzelt | first6 = M. | last7 = Sakamoto | first7 = Y. | last8 = Suzuki | first8 = T. | title = Structural Order in Perfluoropentacene Thin Films and Heterostructures with Pentacene | journal = Langmuir | year = 2008 | volume = 24 | issue = 14 | pages = 7294–7298 | doi = 10.1021/la800606h | pmid = 18547077 }} It has a blueish-black color, and is used for molecular thin-film devices (like OLEDs or OFETs).