Perphenazine enanthate

{{Short description|Typical antipsychotic medication}}

{{Infobox drug

| drug_name =

| image = Perphenazine enanthate.svg

| width = 250px

| caption =

| pronounce =

| tradename = Decentan Depot, Peratsin Enantaatti, Trilafon, Trilafon Enantato, Trilafon Enantat, Trilifan Retard

| Drugs.com =

| MedlinePlus =

| licence_CA =

| licence_EU =

| DailyMedID =

| licence_US =

| pregnancy_AU =

| pregnancy_category =

| dependency_liability =

| addiction_liability =

| routes_of_administration = Intramuscular injection

| class = Typical antipsychotic

| ATC_prefix = N05

| ATC_suffix = AB03

| legal_status = Rx-only

| bioavailability =

| protein_bound =

| metabolism =

| metabolites =

| onset =

| elimination_half-life =

| duration_of_action =

| excretion =

| CAS_number = 17528-28-8

| CAS_supplemental =

| PubChem = 62871

| IUPHAR_ligand =

| DrugBank = DB14651

| ChemSpiderID = 56601

| UNII = Z6RS3DKN8J

| KEGG = D08342

| ChEBI =

| ChEMBL =

| NIAID_ChemDB =

| PDB_ligand =

| synonyms = Perphenazine enantate

| IUPAC_name = 2-[4-[3-(2-chlorophenothiazin-10-yl)propyl]piperazin-1-yl]ethyl heptanoate

| C=28 | H=38 | Cl=1 | N=3 | O=2 | S=1

| SMILES = CCCCCCC(=O)OCCN1CCN(CC1)CCCN2C3=CC=CC=C3SC4=C2C=C(C=C4)Cl

| StdInChI = 1S/C28H38ClN3O2S/c1-2-3-4-5-11-28(33)34-21-20-31-18-16-30(17-19-31)14-8-15-32-24-9-6-7-10-26(24)35-27-13-12-23(29)22-25(27)32/h6-7,9-10,12-13,22H,2-5,8,11,14-21H2,1H3

| StdInChIKey = PWEGQJCIAMJJHC-UHFFFAOYSA-N

}}

Perphenazine enanthate, sold under the brand name Trilafon Enantat among others, is a typical antipsychotic and a depot antipsychotic ester which is used in the treatment of schizophrenia and has been marketed in Europe.{{cite book | editor = Swiss Pharmaceutical Society | author = Swiss Pharmaceutical Society | date = 2000 | title = Index Nominum 2000: International Drug Directory | publisher = Taylor & Francis | pages = 811– | isbn = 978-3-88763-075-1 | url = https://books.google.com/books?id=5GpcTQD_L2oC&pg=PA811}}{{cite journal | vauthors = Altamura AC, Sassella F, Santini A, Montresor C, Fumagalli S, Mundo E | title = Intramuscular preparations of antipsychotics: uses and relevance in clinical practice | journal = Drugs | volume = 63 | issue = 5 | pages = 493–512 | date = 2003 | pmid = 12600227 | doi = 10.2165/00003495-200363050-00004 | s2cid = 46973260 | url = }}{{cite journal | vauthors = Davis JM, Matalon L, Watanabe MD, Blake L, Metalon L | title = Depot antipsychotic drugs. Place in therapy | journal = Drugs | volume = 47 | issue = 5 | pages = 741–73 | date = May 1994 | pmid = 7520856 | doi = 10.2165/00003495-199447050-00004 | s2cid = 46962898 | url = }}{{cite journal | vauthors = Taylor D | title = Psychopharmacology and adverse effects of antipsychotic long-acting injections: a review | journal = Br J Psychiatry Suppl | volume = 52 | issue = | pages = S13–9 | date = November 2009 | pmid = 19880912 | doi = 10.1192/bjp.195.52.s13 | s2cid = 1692443 | url = | doi-access = free }}{{cite journal | vauthors = Spanarello S, La Ferla T | title = The pharmacokinetics of long-acting antipsychotic medications | journal = Curr Clin Pharmacol | volume = 9 | issue = 3 | pages = 310–7 | date = 2014 | pmid = 23343447 | doi = 10.2174/15748847113089990051 | url = }}{{cite journal | vauthors = De Risio A, Lang AP | title = History and therapeutic rationale of long acting antipsychotics | journal = Curr Clin Pharmacol | volume = 9 | issue = 1 | pages = 39–52 | date = February 2014 | pmid = 23343446 | doi = 10.2174/15748847113089990057 | url = }} It is formulated in sesame oil and administered by intramuscular injection and acts as a long-lasting prodrug of perphenazine. Perphenazine enanthate is used at a dose of 25 to 200 mg once every 2 weeks by injection, with a time to peak levels of 2 to 3 days and an elimination half-life of 4 to 7 days.

{{Pharmacokinetics of long-acting injectable antipsychotics}}