Peruvoside

{{Short description|Chemical compound}}

{{Drugbox

| Verifiedfields = changed

| verifiedrevid = 464199541

| IUPAC_name = (3β,5β,8ξ,9ξ)- 3-[(6-deoxy- 3-O-methyl- α-D- glycero- hexopyranosyl)oxy]- 14-hydroxy- 19-oxocard- 20(22)enolide

| image = Peruvoside.svg

| tradename =

| pregnancy_AU =

| pregnancy_US =

| pregnancy_category =

| legal_AU =

| legal_CA =

| legal_UK =

| legal_US =

| legal_status =

| routes_of_administration =

| bioavailability =

| protein_bound =

| metabolism =

| elimination_half-life =

| excretion =

| CAS_number_Ref = {{cascite|changed|??}}

| CAS_number = 1182-87-2

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = CT36KGC6A6

| ATC_prefix = C01

| ATC_suffix = AX02

| PubChem = 14449

| DrugBank_Ref = {{drugbankcite|correct|drugbank}}

| DrugBank =

| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}

| ChemSpiderID = 16498835

| ChEMBL_Ref = {{ebicite|correct|EBI}}

| ChEMBL = 1075790

| C=30 | H=44 | O=9

| smiles = O=C\1OC/C(=C/1)[C@H]6CC[C@@]5(O)[C@]6(C)CC[C@H]3[C@H]5CC[C@@H]4C[C@@H](O[C@@H]2O[C@@H](C)[C@H](O)[C@@H](OC)[C@@H]2O)CC[C@]34C=O

| StdInChI_Ref = {{stdinchicite|correct|chemspider}}

| StdInChI = 1S/C30H44O9/c1-16-24(33)26(36-3)25(34)27(38-16)39-19-6-10-29(15-31)18(13-19)4-5-22-21(29)7-9-28(2)20(8-11-30(22,28)35)17-12-23(32)37-14-17/h12,15-16,18-22,24-27,33-35H,4-11,13-14H2,1-3H3/t16-,18+,19-,20+,21-,22+,24-,25-,26+,27-,28+,29+,30-/m0/s1

| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}

| StdInChIKey = PMTSPAGBAFCORP-HBUONDEYSA-N

| synonyms = (3S,5R,10R,13R,14S,17R)- 3-[(2S,5R)- 3,5-dihydroxy- 4-methoxy- 6-methyloxan- 2-yl]oxy- 14-hydroxy- 13-methyl- 17-(5-oxo-2H-furan-3-yl)- 1,2,3,4,5,6,7,8,9,11,12,15,16,17- tetradecahydrocyclopenta[a]phenanthrene- 10-carbaldehyde

}}{{Technical|date=February 2021}}

Peruvoside (or cannogenin thevetoside) is a cardiac glycoside{{ cite book | title = Peruvoside and Other Cardiotonic Glycoside[s] of Thevetia neriifolia Juss: Chemical, Pharmacological, and Clinical Studies | vauthors = Arora RB, Rangaswami S | year = 1972 | publisher = Thomson | location = New Delhi, India | lccn = 78900408}} for heart failure.{{cite journal | vauthors = Bhatia ML, Manchanda SC, Roy SB | title = Haemodynamic studies with peruvoside in human congestive heart failure | journal = British Medical Journal | volume = 3 | issue = 5725 | pages = 740–3 | date = September 1970 | pmid = 4919553 | pmc = 1701679 | doi = 10.1136/bmj.3.5725.740 }}

It is derived from Cascabela thevetia (Thevetia neriifolia).