Phaseolin (pterocarpan)

{{chembox

| Verifiedfields = changed

| Watchedfields = changed

| verifiedrevid = 415505260

| Name = Phaseolin

| ImageFile = Phaseolin structure.svg

| ImageSize = 200px

| ImageName = Chemical structure of phaseolin

| ImageAlt = Chemical structure of phaseolin

| IUPACName = 3,3-Dimethyl-6b,12b-dihydro-3H,7H-furo[3,2-c:5,4-f']dichromen-10-ol

| OtherNames = Phaseollin
Abyssinone I
(-)-Phaseollin

|Section1={{Chembox Identifiers

| CASNo = 13401-40-6

| CASNo_Ref = {{cascite|correct|??}}

| CASNoOther =

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = 8OHL7771FZ

| PubChem = 91572

| ChEBI_Ref = {{ebicite|changed|EBI}}

| ChEBI = 108

| ChEMBL_Ref = {{ebicite|changed|EBI}}

| ChEMBL = 448350

| SMILES = [H][C@]12C3=CC=C(O)C=C3OC[C@@]1([H])C4=C(C(C=CC(C)(C)O5)=C5C=C4)O2

| ChemSpiderID = 82683

| StdInChI = 1S/C20H18O4/c1-20(2)8-7-14-16(24-20)6-5-12-15-10-22-17-9-11(21)3-4-13(17)19(15)23-18(12)14/h3-9,15,19,21H,10H2,1-2H3/t15-,19-/m0/s1

| StdInChIKey = LWTDZKXXJRRKDG-KXBFYZLASA-N

| MeSHName =

}}

|Section2={{Chembox Properties

| C=20 | H=18 | O=4

| Appearance =

| Density =

| MeltingPt =

| BoilingPt =

| Solubility =

}}

|Section3={{Chembox Hazards

| MainHazards =

| FlashPt =

| AutoignitionPt =

| HPhrases =

| PPhrases =

| GHS_ref =

}}

}}

Phaseolin is a prenylated pterocarpan found in French bean (Phaseolus vulgaris) seedsPhenolic compounds in relation to phytoalexin biosynthesis in hypocotyls of Phaseolus vulgaris. W.G. Rathmell and D.S. Bendall, Physiological Plant Pathology, Volume 1, Issue 3, July 1971, Pages 351-362, {{doi|10.1016/0048-4059(71)90055-5}}Phaseollin and phaseollidin relationships in infection-droplets on endocarp of Phaseolus vulgaris. I.A.M. Cruickshank, D.R. Biggs, Dawn R. Perrin and C.P. Whittle, Physiological Plant Pathology, Volume 4, Issue 2, April 1974, Pages 261-276, {{doi|10.1016/0048-4059(74)90014-9}} and in the stems of Erythrina subumbrans.Antibacterial Pterocarpans from Erythrina subumbrans. Thitima Rukachaisirikul, Phongsak Innok, Nuntana Aroonrerk, Woraluk Boonamnuaylap, Saranya Limrangsun, Chanakan Boonyon, Umpawan Woonjina and Apichart Suksamrarn, Journal of Ethnopharmacology, Volume 110, Issue 1, 1 March 2007, Pages 171-175, {{doi|10.1016/j.jep.2006.09.022}}