Pheneturide

{{Short description|Chemical compound}}

{{Drugbox

| Verifiedfields = changed

| Watchedfields = changed

| verifiedrevid = 464200183

| IUPAC_name = (RS)-N-Carbamoyl-2-phenyl-butanamide

| image = Pheneturide.svg

| width = 175

| chirality = Racemic mixture

| tradename =

| Drugs.com = {{drugs.com|international|pheneturide}}

| pregnancy_category =

| legal_status =

| routes_of_administration =

| bioavailability =

| metabolism =

| excretion =

| CAS_number_Ref = {{cascite|changed|??}}

| CAS_number = 90-49-3

| ATC_prefix = N03

| ATC_suffix = AX13

| PubChem = 72060

| DrugBank_Ref = {{drugbankcite|correct|drugbank}}

| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}

| ChemSpiderID = 65046

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = 878CEJ4HGX

| KEGG_Ref = {{keggcite|correct|kegg}}

| KEGG = D01190

| C=11 | H=14 | N=2 | O=2

| smiles = O=C(N)NC(=O)C(c1ccccc1)CC

| StdInChI_Ref = {{stdinchicite|correct|chemspider}}

| StdInChI = 1S/C11H14N2O2/c1-2-9(10(14)13-11(12)15)8-6-4-3-5-7-8/h3-7,9H,2H2,1H3,(H3,12,13,14,15)

| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}

| StdInChIKey = AJOQSQHYDOFIOX-UHFFFAOYSA-N

}}

Pheneturide (INN, BAN) (brand names Benuride, Deturid, Pheneturid, Septotence, Trinuride),{{cite book|author=Muller|title=European Drug Index: European Drug Registrations, Fourth Edition|url=https://books.google.com/books?id=HiSdvzs2pPAC&pg=PA998|date=19 June 1998|publisher=CRC Press|isbn=978-3-7692-2114-5|pages=998–}} also known as phenylethylacetylurea (or ethylphenacemide), is an anticonvulsant of the ureide class.{{cite book| vauthors = Elks J |title=The Dictionary of Drugs: Chemical Data: Chemical Data, Structures and Bibliographies|url=https://books.google.com/books?id=0vXTBwAAQBAJ&pg=PA959|date=14 November 2014|publisher=Springer|isbn=978-1-4757-2085-3|pages=959–}}{{cite journal | vauthors = Byrne B, Rothchild R | title = 1H NMR studies of drugs with achiral and chiral lanthanide shift reagents: applications to the anticonvulsant pheneturide | journal = Chirality | volume = 11 | issue = 7 | pages = 529–35 | year = 1999 | pmid = 10423278 | doi = 10.1002/(SICI)1520-636X(1999)11:7<529::AID-CHIR3>3.0.CO;2-K }} Conceptually, it can be formed in the body as a metabolic degradation product from phenobarbital. It is considered to be obsolete{{cite book| vauthors = Levy RH |title=Antiepileptic Drugs|url=https://books.google.com/books?id=HAOY0qG-vAYC&pg=PA210|year=2002|publisher=Lippincott Williams & Wilkins|isbn=978-0-7817-2321-3|pages=210–}} and is now seldom used.{{cite book| vauthors = Denham MJ |title=The Treatment of Medical Problems in the Elderly|url=https://books.google.com/books?id=VFIBCAAAQBAJ&pg=PT335|date=6 December 2012|publisher=Springer Science & Business Media|isbn=978-94-011-6223-4|pages=335–}} It is marketed in Europe, including in Poland, Spain and the United Kingdom.{{cite book| first = Julius | last = Vida | name-list-style = vanc |title=Anticonvulsants|url=https://books.google.com/books?id=u-qOecoMmqMC&pg=PA4|date=19 July 2013|publisher=Elsevier|isbn=978-0-323-14395-0|pages=4,42}} Pheneturide has a similar profile of anticonvulsant activity and toxicity relative to phenacemide.{{cite book| veditors = deStevens G, Zingel V, Leschke C, Hoeprich PD, Schultz RM, Mehrotra PK, Batra S, Bhaduri AP, Saxena AK, Saxena M |title=Progress in Drug Research / Fortschritte der Arzneimittelforschung / Progrès des Recherches Pharmaceutiques|date=11 November 2013|publisher=Birkhäuser|location=Basel|isbn=978-3-0348-7161-7|pages=217–|url=https://books.google.com/books?id=2mT0BwAAQBAJ&pg=PA217|access-date=3 September 2016}}{{cite book| first = Richard | last = Lancaster | name-list-style = vanc |title=Pharmacology in Clinical Practice|url=https://books.google.com/books?id=tQ8lBQAAQBAJ&pg=PA222|date=22 October 2013|publisher=Elsevier|isbn=978-1-4831-9294-9|pages=222–}} As such, it is only used in cases of severe epilepsy when other, less-toxic drugs have failed. Pheneturide inhibits the metabolism and thus increases the levels of other anticonvulsants, such as phenytoin.