Phenylmercuric nitrate

{{Short description|Organomercury compound with powerful antiseptic and antifungal effects}}

{{chembox

|ImageFile = Phenylmercuric nitrate.svg

|ImageFile1 = Phenylmercuric-nitrate-3D-vdW.png

|OtherNames =

|IUPACName = nitrooxy(phenyl)mercury

|Section1 = {{Chembox Identifiers

|ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}

|CASNo_Ref = {{cascite|correct|??}}

|CASNo = 55-68-5

|UNII_Ref = {{fdacite|correct|FDA}}

|UNII = CG8692ZN14

|PubChem = 16682924

|ChemSpiderID = 13854801

|EC_number = 200-242-9

|RTECS = OW8400000

|UNNumber = 1895

|ChEBI = 136021

|SMILES = C1=CC=C(C=C1)[Hg]O[N+](=O)[O-]

|StdInChI=1S/C6H5.Hg.NO3/c1-2-4-6-5-3-1;;2-1(3)4/h1-5H;;/q;+1;-1

|StdInChIKey = PDTFCHSETJBPTR-UHFFFAOYSA-N

}}

|Section2 = {{Chembox Properties

|C=6 | H=5 | Hg=1 | N=1 | O=3

|MolarMass = 339.702 g/mol

| MeltingPtC = 176-186

}}

|Section3 = {{Chembox Hazards

|GHSPictograms = {{GHS05}}{{GHS06}}{{GHS08}}{{GHS09}}

|GHSSignalWord = Danger

|HPhrases = {{H-phrases|301|314|372|410}}

|PPhrases = {{P-phrases|260|264|270|273|280|301+310|301+330+331|303+361+353|304+340|305+351+338|310|314|321|330|363|391|405|501}}

|MainHazards = Toxic

}}

}}

Phenylmercuric nitrate is an organomercury compound with powerful antiseptic and antifungal effects.{{Cite journal|doi=10.1016/j.diagmicrobio.2012.09.008|pmid=23102555|year=2013|last1=Xu|first1=Y.|title=Antifungal effect of ophthalmic preservatives phenylmercuric nitrate and benzalkonium chloride on ocular pathogenic filamentous fungi|journal=Diagnostic Microbiology and Infectious Disease|volume=75|issue=1|pages=64–7|last2=He|first2=Y.|last3=Li|first3=X.|last4=Gao|first4=C.|last5=Zhou|first5=L.|last6=Sun|first6=S.|last7=Pang|first7=G.}} It was once commonly used as a topical solution for disinfecting wounds, but as with all organomercury compounds it is highly toxic, especially to the kidneys, and is no longer used in this application. However it is still used in low concentrations as a preservative in eye drops for ophthalmic use, making it one of the few organomercury derivatives remaining in current medical use.{{Cite journal|doi=10.1080/15569520902995834|pmid=19505226|year=2009|last1=Kaur|first1=I. P.|title=Ocular preservatives: Associated risks and newer options|journal=Cutaneous and Ocular Toxicology|volume=28|issue=3|pages=93–103|last2=Lal|first2=S.|last3=Rana|first3=C.|last4=Kakkar|first4=S.|last5=Singh|first5=H.|s2cid=9806996}}