Phosalacine

{{Chembox

| ImageFile = Phosalacine.svg

| ImageSize = 200px

| IUPACName = (2S)-2-[[(2S)-2-[[(2S)-2-amino-4-[hydroxy(methyl)phosphoryl]butanoyl]amino]propanoyl]amino]-4-methylpentanoic acid

| OtherNames = (2S)-2-Amino-4-(hydroxymethylphosphinyl)butanoyl-L-alanyl-L-leucine

| Section1 = {{Chembox Identifiers

| CASNo = 92567-89-0

| ChemSpiderID = 62917600

| PubChem = 13564971

| SMILES = C[C@@H](C(=O)N[C@@H](CC(C)C)C(=O)O)NC(=O)[C@H](CCP(=O)(C)O)N

| StdInChI=1S/C14H28N3O6P/c1-8(2)7-11(14(20)21)17-12(18)9(3)16-13(19)10(15)5-6-24(4,22)23/h8-11H,5-7,15H2,1-4H3,(H,16,19)(H,17,18)(H,20,21)(H,22,23)/t9-,10-,11-/m0/s1

| StdInChIKey = GRIZBDACBCXJCF-DCAQKATOSA-N

}}

| Section2 = {{Chembox Properties

| C = 14 | H = 28 | N = 3 | O = 6 | P = 1

| Appearance =

| Density =

| MeltingPt =

| BoilingPt =

| Solubility =

}}

| Section3 = {{Chembox Hazards

| MainHazards =

| FlashPt =

| AutoignitionPt =

}}

}}

Phosalacine is a natural antimicrobial and herbicidal compound that has been isolated from the Actinobacteria Kitasatosporia phosalacinea.{{cite journal | doi = 10.7164/antibiotics.37.829 | title = Phosalacine, a new herbicidal antibiotic containing phosphinothricin. Fermentation, isolation, biological activity and mechanism of action | year = 1984 | last1 = Omura | first1 = Satoshi | last2 = Murata | first2 = Masatsune | last3 = Hanaki | first3 = Hideaki | last4 = Hinotozawa | first4 = Kiyoizumi | last5 = Oiwa | first5 = Ruiko | last6 = Tanaka | first6 = Haruo | journal = The Journal of Antibiotics | volume = 37 | issue = 8 | pages = 829–835 | pmid = 6480502 | doi-access = free }}

It is a tripeptide consisting of the amino acids glufosinate (phosphinothricin), alanine, and leucine.{{cite journal | doi = 10.7164/antibiotics.37.939 | title = The structure of phosalacine, a new herbicidal antibiotic containing phosphinothricin | year = 1984 | last1 = Omura | first1 = Satoshi | last2 = Hinotozawa | first2 = Kiyoizumi | last3 = Imamura | first3 = Nobutaka | last4 = Murata | first4 = Masatsune | journal = The Journal of Antibiotics | volume = 37 | issue = 8 | pages = 939–940 | pmid = 6480509 | s2cid = 9186238 | doi-access = free }} It is similar in structure to bialaphos, differing by replacement of the terminal alanine with leucine.

Phosalacine has antimicrobial activity against Gram-positive and Gram-negative bacteria and some fungi. It also shows herbicidal activity against alfalfa. It is believed that the herbicidal activity is due to the slow release of glufosinate,{{cite book | doi = 10.1021/bk-1988-0380.ch013 | chapter = Naturally Occurring Carbon—Phosphorus Compounds as Herbicides | title = Biologically Active Natural Products | series = ACS Symposium Series | year = 1988 | last1 = Hoagland | first1 = Robert E. | volume = 380 | pages = 182–210 | isbn = 9780841215566 }} which is a commercially-used broad spectrum herbicide.