Phosphamidon

{{distinguish|phosphoramidon}}

{{chembox

| Verifiedfields = changed

| Watchedfields = changed

| verifiedrevid = 444050677

| ImageFile =(E,Z)-Phosphamidon Structural Formulae V.1.svg

| ImageSize =360px

| IUPACName =(E/Z)-[3-Chloro-4-(diethylamino)-4-oxobut-2-en-2-yl] dimethyl phosphate

| OtherNames =Dimecron

|Section1={{Chembox Identifiers

| CASNo_Ref = {{cascite|correct|CAS}}

| CASNo = 13171-21-6

| CASNo2_Ref = {{cascite|correct|CAS}}

| CASNo2 = 297-99-4

| CASNo2_Comment = (E)

| CASNo3_Ref = {{cascite|correct|CAS}}

| CASNo3 = 23783-98-4

| CASNo3_Comment = (Z)

| PubChem =25750

| KEGG_Ref = {{keggcite|correct|kegg}}

| KEGG = C18689

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = 7H857A6N6H

| UNII1_Ref = {{fdacite|correct|FDA}}

| UNII1 = 54VR7A0BQD

| UNII1_Comment = (E)

| UNII2_Ref = {{fdacite|correct|FDA}}

| UNII2 = HQ7958Q90Z

| UNII2_Comment = (Z)

| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}}

| ChemSpiderID = 23990

| SMILES = CCN(CC)C(=O)/C(=C(\C)/OP(=O)(OC)OC)/Cl

| InChI = 1/C10H19ClNO5P/c1-6-12(7-2)10(13)9(11)8(3)17-18(14,15-4)16-5/h6-7H2,1-5H3

| InChIKey = RGCLLPNLLBQHPF-UHFFFAOYAA

| StdInChI_Ref = {{stdinchicite|changed|chemspider}}

| StdInChI = 1S/C10H19ClNO5P/c1-6-12(7-2)10(13)9(11)8(3)17-18(14,15-4)16-5/h6-7H2,1-5H3

| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}}

| StdInChIKey = RGCLLPNLLBQHPF-UHFFFAOYSA-N

}}

|Section2={{Chembox Properties

| C=10|H=19|Cl=1|N=1|O=5|P=1

| Appearance =

| Density =1.2132 g/cm³[http://www.inchem.org/documents/pds/pds/pest74_e.htm Data Sheet on Pesticides No. 74: Phosphamidon], International Programme on Chemical Safety

| MeltingPtC =

| MeltingPt_ref =

| BoilingPtC = 162

| BoilingPt_notes = (1.5 mmHg){{cite journal | title = Phosphamidon, a new phosphate ester with systemic action | author = Bachmann, Fritz | journal = Proc. Intern. Cong. Crop. Protection, 4th Congr., Hamburg |year = 1960 | volume = 2 | pages = P1153-1155}}

| Solubility =Miscible

}}

|Section3={{Chembox Hazards

| MainHazards =

| FlashPt =

| AutoignitionPt =

| LD50 = 13 mg/kg (mouse, oral){{cite journal | title = Toxicology and pharmacology of a new systemic phosphoric acid ester insecticide phosphamidon (2-chloro-2-diethylcarbamoyl-1-methylvinyl dimethyl phosphate) |author1=Jacques, R. |author2=Bein, H. J. | journal = Archiv für Toxikologie | year = 1960 | volume = 18 | pages = 316–330|doi=10.1007/BF02226232 |s2cid=6714997 }}
6 mg/kg (mouse, IV)
20 mg/kg (rat, oral)
26 mg/kg (rat, subcut.)

}}

}}

Phosphamidon is an organophosphate insecticide first reported in 1960. It acts as a cholinesterase inhibitor.

The commercial product typically exists as a mixture of 70% (Z)-isomer and 30% (E)-isomer.