Phthalimidoperoxycaproic acid
{{Chembox
| ImageFile = Phthalimidoperoxycaproic_acid.svg
| ImageSize = 200px
| ImageAlt =
| PIN = 6-(1,3-Dioxo-1,3-dihydro-2H-isoindol-2-yl)hexaneperoxoic acid
| OtherNames =
| Section1 = {{Chembox Identifiers
| CASNo = 128275-31-0
| EC_number = 410-850-8
| UNII = 5OEJ6FAL6C
| ChemSpiderID = 8036120
| InChI=1S/C14H15NO5/c16-12(20-19)8-2-1-5-9-15-13(17)10-6-3-4-7-11(10)14(15)18/h3-4,6-7,19H,1-2,5,8-9H2
| StdInChIKey = UZJGVXSQDRSSHU-UHFFFAOYSA-N
| PubChem = 9860421
| SMILES = C1=CC=C2C(=C1)C(=O)N(C2=O)CCCCCC(=O)OO
}}
| Section2 = {{Chembox Properties
| C=14 | H=15 | N=1 | O=5
| Appearance =
| Density =
| MeltingPt =
| BoilingPt =
| Solubility =
}}
| Section3 = {{Chembox Hazards
| GHSPictograms = {{GHS02}}{{GHS05}}{{GHS09}}{{PubChem|9860421}}
| GHSSignalWord = Danger
| HPhrases = {{H-phrases|242|318|400}}
| PPhrases = {{P-phrases|210|220|234|273|280|305+351+338|310|370+378|391|403+235|411|420|501}}
| MainHazards =
| FlashPt =
| AutoignitionPt =
}}
}}
Phthalimidoperoxycaproic acid (ε- or 6-(phthalimido)peroxyhexanoic acid, abbreviated as PAP) is a synthetic organic peroxy acid derived from caprolactam and phthalic anhydride.{{Cite book|url=https://books.google.com/books?id=2mrLBQAAQBAJ|title=Handbook of Detergents, Part E: Applications|last=Zoller|first=Uri|date=2008-10-29|publisher=CRC Press|isbn=9781420018165|pages=378–379|language=en}} The compound is mainly used as a preformed bleaching agent, alternatively to or together with hydrogen peroxide, in moderate laundry conditions of pH and temperature. It is also used as a tooth whitening agent.{{Cite journal|last1=Bizhang|first1=Mozhgan|last2=Domin|first2=Julia|last3=Danesh|first3=Gholamreza|last4=Zimmer|first4=Stefan|date=2017|title=Effectiveness of a new non-hydrogen peroxide bleaching agent after single use - a double-blind placebo-controlled short-term study|journal=Journal of Applied Oral Science|volume=25|issue=5|pages=575–584|doi=10.1590/1678-7757-2016-0463|issn=1678-7757|pmc=5804394|pmid=29069156}} PAP is a white odorless crystalline powder at room temperature. It is slightly soluble in water and a strong oxidizer.{{Cite patent|title=Crystalline forms of imidoalkanpercarboxylic acids|gdate=2003-07-08| country = EP | number = 1523474}}