Picralinal

{{Chembox

| ImageFile = Picralinal.svg

| ImageSize =

| ImageAlt =

| IUPACName = methyl (14E)-14-ethylidene-19-formyl-18-oxa-2,12-diazahexacyclo[9.6.1.1^9,15.0^1,9.0^3,8.0^12,17]nonadeca-3,5,7-triene-19-carboxylate

| OtherNames =

|Section1={{Chembox Identifiers

| CASNo = 20045-06-1

| PubChem = 5320550

| ChemSpiderID = 10258953

| StdInChI=1S/C21H22N2O4/c1-3-12-10-23-16-8-14(12)19(11-24,18(25)26-2)20-9-17(23)27-21(16,20)22-15-7-5-4-6-13(15)20/h3-7,11,14,16-17,22H,8-10H2,1-2H3/b12-3-

| StdInChIKey = RHBAENOZUZWALZ-BASWHVEKSA-N

| SMILES = C/C=C\1/CN2C3CC1C(C45C3(NC6=CC=CC=C64)OC2C5)(C=O)C(=O)OC

}}

|Section2={{Chembox Properties

| C=21 | H=22 | N=2 | O=4

| Formula =

| MolarMass =

| Appearance =

| Density =

| MeltingPt =

| BoilingPt =

| Solubility = }}

|Section3={{Chembox Hazards

| MainHazards =

| FlashPt =

| AutoignitionPt = }}

}}

Picralinal is a bio-active alkaloid from Alstonia scholaris, a medicinal tree of West Africa.{{cite journal |title=A Review of the Ethnobotany and Pharmacological Importance of Alstonia boonei De Wild (Apocynaceae) | first1=John Prosper Kwaku | last1=Adotey|display-authors=etal|journal=ISRN Pharmacology | volume=2012 | date=2012 | doi=10.5402/2012/587160|pmid=22900200 |pmc=3413980 | pages=587160 | doi-access=free }}