Pidotimod

{{Short description|Chemical compound}}

{{Drugbox

| Verifiedfields = changed

| verifiedrevid = 464206452

| IUPAC_name = (4R)-3-(5-oxo-L-prolyl)-1,3-thiazolidine-4-carboxylic acid

| image = Pidotimod.png

| tradename =

| Drugs.com = {{drugs.com|international|pidotimod}}

| pregnancy_AU =

| pregnancy_US =

| pregnancy_category =

| legal_AU =

| legal_CA =

| legal_UK =

| legal_US =

| legal_status =

| routes_of_administration =

| bioavailability =

| protein_bound =

| metabolism =

| elimination_half-life =

| excretion =

| CAS_number_Ref = {{cascite|correct|??}}

| CAS_number = 121808-62-6

| ATC_prefix = L03

| ATC_suffix = AX05

| PubChem = 65944

| DrugBank_Ref = {{drugbankcite|correct|drugbank}}

| DrugBank =

| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}

| ChemSpiderID = 59348

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = 785363R681

| KEGG_Ref = {{keggcite|correct|kegg}}

| KEGG = D07261

| ChEMBL_Ref = {{ebicite|changed|EBI}}

| ChEMBL = 1488165

| C=9 | H=12 | N=2 | O=4 | S=1

| smiles = O=C(O)[C@H]2N(C(=O)[C@H]1NC(=O)CC1)CSC2

| StdInChI_Ref = {{stdinchicite|correct|chemspider}}

| StdInChI = 1S/C9H12N2O4S/c12-7-2-1-5(10-7)8(13)11-4-16-3-6(11)9(14)15/h5-6H,1-4H2,(H,10,12)(H,14,15)/t5-,6-/m0/s1

| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}

| StdInChIKey = UUTKICFRNVKFRG-WDSKDSINSA-N

| synonyms = (4R)-3-[(2S)-5-oxopyrrolidine-2-carbonyl]-1,3-thiazolidine-4-carboxylic acid

}}

Pidotimod is an immunostimulant.{{cite journal |vauthors=Du XF, Jiang CZ, Wu CF, Won EK, Choung SY |title=Synergistic immunostimulating activity of pidotimod and red ginseng acidic polysaccharide against cyclophosphamide-induced immunosuppression |journal=Archives of Pharmacal Research |volume=31 |issue=9 |pages=1153–9 |date=September 2008 |pmid=18806958 |doi=10.1007/s12272-001-1282-6|s2cid=207408882 |doi-access=free }}