Pigment Red 179

{{Chembox

| ImageFile = PigmentRed179.png

| ImageSize = 340px

| ImageAlt =

| PIN = 2,9-Dimethylanthra[2,1,9-def:6,5,10-d′e′f′]diisoquinoline-1,3,8,10(2H,9H)-tetrone

| OtherNames =

|Section1={{Chembox Identifiers

| CASNo = 5521-31-3

| EINECS = 226-866-1

| PubChem = 79657

| ChemSpiderID = 71958

| SMILES = CN1C(=O)c2ccc3c4ccc5c6c4c(ccc6C(=O)N(C5=O)C)c7c3c2c(cc7)C1=O

| StdInChI = 1S/C26H14N2O4/c1-27-23(29)15-7-3-11-13-5-9-17-22-18(26(32)28(2)25(17)31)10-6-14(20(13)22)12-4-8-16(24(27)30)21(15)19(11)12/h3-10H,1-2H3

| StdInChIKey = PJQYNUFEEZFYIS-UHFFFAOYSA-N}}

|Section2={{Chembox Properties

| Formula = C₂₆H₁₄N₂O₄

| MolarMass = 418.40

| Appearance =

| Density =

| MeltingPt =

| BoilingPt =

| Solubility = }}

|Section3={{Chembox Hazards

| MainHazards =

| FlashPt =

| AutoignitionPt = }}

}}

Pigment Red 179 is an organic compound used as a pigment. Structurally, it is a derivative of perylene, produced from perylenetetracarboxylic dianhydride through derivatization with methylamine.K. Hunger. W. Herbst "Pigments, Organic" in Ullmann's Encyclopedia of Industrial Chemistry, Wiley-VCH, Weinheim, 2012. {{doi|10.1002/14356007.a20_371}}Greene, M. "Perylene Pigments" in High Performance Pigments, 2009, Wiley-VCH, Weinheim. {{doi|10.1002/9783527626915.ch16}}

pp. 261-274.

It is used in watercolor paints, usually labeled as Perylene Maroon.