Pigment Yellow 3

{{Chembox

| ImageFile = PigYellow3corrected.svg

| ImageSize = 110

| ImageAlt =

| IUPACName =

| OtherNames =

|Section1={{Chembox Identifiers

| CASNo = 6486-23-3

| CASNo_Ref = {{Cascite|correct|CAS}}

| ChemSpiderID = 21172535

| EC_number = 229-355-1

| PubChem = 94326

| UNII = L885GOC9B6

| StdInChI=1S/C16H12Cl2N4O4/c1-9(23)15(16(24)19-12-5-3-2-4-11(12)18)21-20-13-7-6-10(17)8-14(13)22(25)26/h2-8,15H,1H3,(H,19,24)

| StdInChIKey = QTSNFLIDNYOATQ-UHFFFAOYSA-N

| SMILES = CC(=O)C(C(=O)NC1=CC=CC=C1Cl)N=NC2=C(C=C(C=C2)Cl)[N+](=O)[O-]

}}

|Section2={{Chembox Properties

| Formula =

| MolarMass =

| Appearance = yellow solid

| Density =

| MeltingPt =

| MeltingPt_notes =

| BoilingPt =

| BoilingPt_notes =

| Solubility = }}

|Section3={{Chembox Hazards

| MainHazards =

| FlashPt =

| AutoignitionPt = }}

}}

Pigment Yellow 3 is a commercial colorant,https://artistpigments.org/pigments/PY3 sometimes classified as an arylide yellow. In terms of color and structure, it is closely related to Pigment Yellow 1, where the anilide component lacks substituents and the diazo component has methyl in place of chloro.K. Hunger. W. Herbst "Pigments, Organic" in Ullmann's Encyclopedia of Industrial Chemistry, Wiley-VCH, Weinheim, 2012. {{doi|10.1002/14356007.a20_371}}