Pigment Yellow 97

{{Chembox

| ImageFile = PigYellow97CorrectTaut.svg

| ImageSize = 110

| ImageAlt =

| IUPACName =

| OtherNames =

|Section1={{Chembox Identifiers

| CASNo = 12225-18-2

| CASNo_Ref = {{Cascite|correct|CAS}}

| ChemSpiderID = 21160012

| EC_number = 235-427-3

| PubChem = 61559

| UNII = 8ZNH60AHS0

| StdInChI=1S/C26H27ClN4O8S/c1-15(32)25(26(33)28-18-12-20(36-2)17(27)11-21(18)37-3)30-29-19-13-23(39-5)24(14-22(19)38-4)40(34,35)31-16-9-7-6-8-10-16/h6-14,25,31H,1-5H3,(H,28,33)

| StdInChIKey = WNWZKKBGFYKSGA-UHFFFAOYSA-N

| SMILES = CC(=O)C(C(=O)NC1=CC(=C(C=C1OC)Cl)OC)N=NC2=CC(=C(C=C2OC)S(=O)(=O)NC3=CC=CC=C3)OC

}}

|Section2={{Chembox Properties

| C=26|H=27|Cl=1|N=4|O=8|S=1

| Formula =

| MolarMass =

| Appearance = yellow solid

| Density =

| MeltingPt =

| MeltingPt_notes =

| BoilingPt =

| BoilingPt_notes =

| Solubility = }}

|Section3={{Chembox Hazards

| MainHazards =

| FlashPt =

| AutoignitionPt = }}

}}

Pigment Yellow 97 is widely used as a yellow colorant, and is classified as an arylide yellow. It is distinguished by the presence of a sulfonylaminophenyl group, which renders the material particularly insoluble (resistant to migration). It is derived from two fairly complicated precursors. The acetoacetanilide component is made from 2,5-dimethoxy-4-chloroaniline. The azo component is made from a dimethoxyaniline with the sulfonylaminophenyl substituent.he compound is obtained via acetoacetylation of o-tolidine using diketene. The resulting bisacetoacetylated compound is coupled with two equiv of the diazonium salt obtained from 2,4-dichloroaniline.K. Hunger. W. Herbst "Pigments, Organic" in Ullmann's Encyclopedia of Industrial Chemistry, Wiley-VCH, Weinheim, 2012. {{doi|10.1002/14356007.a20_371}} Although it is often depicted as an azo compound, X-ray crystallography shows that the molecule exists as a hydrazone.{{cite journal |doi=10.1016/j.dyepig.2005.07.001 |title=The crystal structure of CI Pigment Yellow 97, a superior performance Hansa yellow pigment |date=2006 |last1=Christie |first1=R. |last2=Hill |first2=J. |last3=Rosair |first3=G. |journal=Dyes and Pigments |volume=71 |issue=3 |pages=194–198 }}